v6

node_modules/snapdragon/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015-2016, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

node_modules/snapdragon/README.md

@@ -0,0 +1,321 @@
+# snapdragon [![NPM version](https://img.shields.io/npm/v/snapdragon.svg?style=flat)](https://www.npmjs.com/package/snapdragon) [![NPM downloads](https://img.shields.io/npm/dm/snapdragon.svg?style=flat)](https://npmjs.org/package/snapdragon) [![Build Status](https://img.shields.io/travis/jonschlinkert/snapdragon.svg?style=flat)](https://travis-ci.org/jonschlinkert/snapdragon)
+
+> Fast, pluggable and easy-to-use parser-renderer factory.
+
+## Install
+
+Install with [npm](https://www.npmjs.com/):
+
+```sh
+$ npm install --save snapdragon
+```
+
+Created by [jonschlinkert](https://github.com/jonschlinkert) and [doowb](https://github.com/doowb).
+
+**Features**
+
+* Bootstrap your own parser, get sourcemap support for free
+* All parsing and compiling is handled by simple, reusable middleware functions
+* Inspired by the parsers in [pug](http://jade-lang.com) and [css](https://github.com/reworkcss/css).
+
+## History
+
+### v0.5.0
+
+**Breaking changes**
+
+Substantial breaking changes were made in v0.5.0! Most of these changes are part of a larger refactor that will be finished in 0.6.0, including the introduction of a `Lexer` class.
+
+* Renderer was renamed to `Compiler`
+* the `.render` method was renamed to `.compile`
+* Many other smaller changes. A more detailed overview will be provided in 0.6.0. If you don't have to time review code, I recommend you wait for the 0.6.0 release.
+
+## Usage examples
+
+```js
+var Snapdragon = require('snapdragon');
+var snapdragon = new Snapdragon();
+```
+
+**Parse**
+
+```js
+var ast = snapdragon.parser('some string', options)
+  // parser middleware that can be called by other middleware
+  .set('foo', function () {})
+  // parser middleware, runs immediately in the order defined
+  .use(bar())
+  .use(baz())
+```
+
+**Render**
+
+```js
+// pass the `ast` from the parse method
+var res = snapdragon.compiler(ast)
+  // compiler middleware, called when the name of the middleware
+  // matches the `node.type` (defined in a parser middleware)
+  .set('bar', function () {})
+  .set('baz', function () {})
+  .compile()
+```
+
+See the [examples](./examples/).
+
+## Getting started
+
+**Parsers**
+
+Parsers are middleware functions used for parsing a string into an ast node.
+
+```js
+var ast = snapdragon.parser(str, options)
+  .use(function() {
+    var pos = this.position();
+    var m = this.match(/^\./);
+    if (!m) return;
+    return pos({
+      // `type` specifies the compiler to use
+      type: 'dot',
+      val: m[0]
+    });
+  })
+```
+
+**AST node**
+
+When the parser finds a match, `pos()` is called, pushing a token for that node onto the ast that looks something like:
+
+```js
+{ type: 'dot',
+  val: '.',
+  position:
+   { start: { lineno: 1, column: 1 },
+     end: { lineno: 1, column: 2 } }}
+```
+
+**Renderers**
+
+Renderers are _named_ middleware functions that visit over an array of ast nodes to compile a string.
+
+```js
+var res = snapdragon.compiler(ast)
+  .set('dot', function (node) {
+    console.log(node.val)
+    //=> '.'
+    return this.emit(node.val);
+  })
+```
+
+**Source maps**
+
+If you want source map support, make sure to emit the position as well.
+
+```js
+var res = snapdragon.compiler(ast)
+  .set('dot', function (node) {
+    return this.emit(node.val, node.position);
+  })
+```
+
+## Docs
+
+### Parser middleware
+
+A parser middleware is a function that returns an abject called a `token`. This token is pushed onto the AST as a node.
+
+**Example token**
+
+```js
+{ type: 'dot',
+  val: '.',
+  position:
+   { start: { lineno: 1, column: 1 },
+     end: { lineno: 1, column: 2 } }}
+```
+
+**Example parser middleware**
+
+Match a single `.` in a string:
+
+1. Get the starting position by calling `this.position()`
+2. pass a regex for matching a single dot to the `.match` method
+3. if **no match** is found, return `undefined`
+4. if a **match** is found, `pos()` is called, which returns a token with:
+  - `type`: the name of the [compiler] to use
+  - `val`: The actual value captured by the regex. In this case, a `.`. Note that you can capture and return whatever will be needed by the corresponding [compiler].
+  - The ending position: automatically calculated by adding the length of the first capture group to the starting position.
+
+## Renderer middleware
+
+Renderers are run when the name of the compiler middleware matches the `type` defined on an ast `node` (which is defined in a parser).
+
+**Example**
+
+Exercise: Parse a dot, then compile it as an escaped dot.
+
+```js
+var ast = snapdragon.parser('.')
+  .use(function () {
+    var pos = this.position();
+    var m = this.match(/^\./);
+    if (!m) return;
+    return pos({
+      // define the `type` of compiler to use
+      type: 'dot',
+      val: m[0]
+    })
+  })
+
+var result = snapdragon.compiler(ast)
+  .set('dot', function (node) {
+    return this.emit('\\' + node.val);
+  })
+  .compile()
+
+console.log(result.output);
+//=> '\.'
+```
+
+## API
+
+### [Parser](lib/parser.js#L19)
+
+Create a new `Parser` with the given `input` and `options`.
+
+**Params**
+
+* `input` **{String}**
+* `options` **{Object}**
+
+### [.define](lib/parser.js#L103)
+
+Define a non-enumberable property on the `Parser` instance.
+
+**Example**
+
+```js
+parser.define('foo', 'bar');
+```
+
+**Params**
+
+* `key` **{String}**: propery name
+* `val` **{any}**: property value
+* `returns` **{Object}**: Returns the Parser instance for chaining.
+
+Set parser `name` with the given `fn`
+
+**Params**
+
+* `name` **{String}**
+* `fn` **{Function}**
+
+Get parser `name`
+
+**Params**
+
+* `name` **{String}**
+
+Push a `token` onto the `type` stack.
+
+**Params**
+
+* `type` **{String}**
+* `returns` **{Object}** `token`
+
+Pop a token off of the `type` stack
+
+**Params**
+
+* `type` **{String}**
+* `returns` **{Object}**: Returns a token
+
+Return true if inside a `stack` node. Types are `braces`, `parens` or `brackets`.
+
+**Params**
+
+* `type` **{String}**
+* `returns` **{Boolean}**
+
+**Example**
+
+```js
+parser.isType(node, 'brace');
+```
+
+**Params**
+
+* `node` **{Object}**
+* `type` **{String}**
+* `returns` **{Boolean}**
+
+### [.define](lib/compiler.js#L71)
+
+Define a non-enumberable property on the `Compiler` instance.
+
+**Example**
+
+```js
+compiler.define('foo', 'bar');
+```
+
+**Params**
+
+* `key` **{String}**: propery name
+* `val` **{any}**: property value
+* `returns` **{Object}**: Returns the Compiler instance for chaining.
+
+## About
+
+### Related projects
+
+* [braces](https://www.npmjs.com/package/braces): Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces… [more](https://github.com/jonschlinkert/braces) | [homepage](https://github.com/jonschlinkert/braces "Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces specification.")
+* [expand-brackets](https://www.npmjs.com/package/expand-brackets): Expand POSIX bracket expressions (character classes) in glob patterns. | [homepage](https://github.com/jonschlinkert/expand-brackets "Expand POSIX bracket expressions (character classes) in glob patterns.")
+* [extglob](https://www.npmjs.com/package/extglob): Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to… [more](https://github.com/jonschlinkert/extglob) | [homepage](https://github.com/jonschlinkert/extglob "Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to glob patterns.")
+* [micromatch](https://www.npmjs.com/package/micromatch): Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch. | [homepage](https://github.com/jonschlinkert/micromatch "Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch.")
+
+### Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
+
+### Contributors
+
+| **Commits** | **Contributor**<br/> | 
+| --- | --- |
+| 106 | [jonschlinkert](https://github.com/jonschlinkert) |
+| 2 | [doowb](https://github.com/doowb) |
+
+### Building docs
+
+_(This document was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme) (a [verb](https://github.com/verbose/verb) generator), please don't edit the readme directly. Any changes to the readme must be made in [.verb.md](.verb.md).)_
+
+To generate the readme and API documentation with [verb](https://github.com/verbose/verb):
+
+```sh
+$ npm install -g verb verb-generate-readme && verb
+```
+
+### Running tests
+
+Install dev dependencies:
+
+```sh
+$ npm install -d && npm test
+```
+
+### Author
+
+**Jon Schlinkert**
+
+* [github/jonschlinkert](https://github.com/jonschlinkert)
+* [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+
+### License
+
+Copyright © 2016, [Jon Schlinkert](https://github.com/jonschlinkert).
+Released under the [MIT license](https://github.com/jonschlinkert/snapdragon/blob/master/LICENSE).
+
+***
+
+_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.1.31, on October 10, 2016._

node_modules/snapdragon/index.js

@@ -0,0 +1,174 @@
+'use strict';
+
+var Base = require('base');
+var define = require('define-property');
+var Compiler = require('./lib/compiler');
+var Parser = require('./lib/parser');
+var utils = require('./lib/utils');
+var regexCache = {};
+var cache = {};
+
+/**
+ * Create a new instance of `Snapdragon` with the given `options`.
+ *
+ * ```js
+ * var snapdragon = new Snapdragon();
+ * ```
+ *
+ * @param {Object} `options`
+ * @api public
+ */
+
+function Snapdragon(options) {
+  Base.call(this, null, options);
+  this.options = utils.extend({source: 'string'}, this.options);
+  this.compiler = new Compiler(this.options);
+  this.parser = new Parser(this.options);
+
+  Object.defineProperty(this, 'compilers', {
+    get: function() {
+      return this.compiler.compilers;
+    }
+  });
+
+  Object.defineProperty(this, 'parsers', {
+    get: function() {
+      return this.parser.parsers;
+    }
+  });
+
+  Object.defineProperty(this, 'regex', {
+    get: function() {
+      return this.parser.regex;
+    }
+  });
+}
+
+/**
+ * Inherit Base
+ */
+
+Base.extend(Snapdragon);
+
+/**
+ * Add a parser to `snapdragon.parsers` for capturing the given `type` using
+ * the specified regex or parser function. A function is useful if you need
+ * to customize how the token is created and/or have access to the parser
+ * instance to check options, etc.
+ *
+ * ```js
+ * snapdragon
+ *   .capture('slash', /^\//)
+ *   .capture('dot', function() {
+ *     var pos = this.position();
+ *     var m = this.match(/^\./);
+ *     if (!m) return;
+ *     return pos({
+ *       type: 'dot',
+ *       val: m[0]
+ *     });
+ *   });
+ * ```
+ * @param {String} `type`
+ * @param {RegExp|Function} `regex`
+ * @return {Object} Returns the parser instance for chaining
+ * @api public
+ */
+
+Snapdragon.prototype.capture = function() {
+  return this.parser.capture.apply(this.parser, arguments);
+};
+
+/**
+ * Register a plugin `fn`.
+ *
+ * ```js
+ * var snapdragon = new Snapdgragon([options]);
+ * snapdragon.use(function() {
+ *   console.log(this);          //<= snapdragon instance
+ *   console.log(this.parser);   //<= parser instance
+ *   console.log(this.compiler); //<= compiler instance
+ * });
+ * ```
+ * @param {Object} `fn`
+ * @api public
+ */
+
+Snapdragon.prototype.use = function(fn) {
+  fn.call(this, this);
+  return this;
+};
+
+/**
+ * Parse the given `str`.
+ *
+ * ```js
+ * var snapdragon = new Snapdgragon([options]);
+ * // register parsers
+ * snapdragon.parser.use(function() {});
+ *
+ * // parse
+ * var ast = snapdragon.parse('foo/bar');
+ * console.log(ast);
+ * ```
+ * @param {String} `str`
+ * @param {Object} `options` Set `options.sourcemap` to true to enable source maps.
+ * @return {Object} Returns an AST.
+ * @api public
+ */
+
+Snapdragon.prototype.parse = function(str, options) {
+  this.options = utils.extend({}, this.options, options);
+  var parsed = this.parser.parse(str, this.options);
+
+  // add non-enumerable parser reference
+  define(parsed, 'parser', this.parser);
+  return parsed;
+};
+
+/**
+ * Compile the given `AST`.
+ *
+ * ```js
+ * var snapdragon = new Snapdgragon([options]);
+ * // register plugins
+ * snapdragon.use(function() {});
+ * // register parser plugins
+ * snapdragon.parser.use(function() {});
+ * // register compiler plugins
+ * snapdragon.compiler.use(function() {});
+ *
+ * // parse
+ * var ast = snapdragon.parse('foo/bar');
+ *
+ * // compile
+ * var res = snapdragon.compile(ast);
+ * console.log(res.output);
+ * ```
+ * @param {Object} `ast`
+ * @param {Object} `options`
+ * @return {Object} Returns an object with an `output` property with the rendered string.
+ * @api public
+ */
+
+Snapdragon.prototype.compile = function(ast, options) {
+  this.options = utils.extend({}, this.options, options);
+  var compiled = this.compiler.compile(ast, this.options);
+
+  // add non-enumerable compiler reference
+  define(compiled, 'compiler', this.compiler);
+  return compiled;
+};
+
+/**
+ * Expose `Snapdragon`
+ */
+
+module.exports = Snapdragon;
+
+/**
+ * Expose `Parser` and `Compiler`
+ */
+
+module.exports.Compiler = Compiler;
+module.exports.Parser = Parser;

node_modules/snapdragon/lib/compiler.js

@@ -0,0 +1,177 @@
+'use strict';
+
+var use = require('use');
+var define = require('define-property');
+var debug = require('debug')('snapdragon:compiler');
+var utils = require('./utils');
+
+/**
+ * Create a new `Compiler` with the given `options`.
+ * @param {Object} `options`
+ */
+
+function Compiler(options, state) {
+  debug('initializing', __filename);
+  this.options = utils.extend({source: 'string'}, options);
+  this.state = state || {};
+  this.compilers = {};
+  this.output = '';
+  this.set('eos', function(node) {
+    return this.emit(node.val, node);
+  });
+  this.set('noop', function(node) {
+    return this.emit(node.val, node);
+  });
+  this.set('bos', function(node) {
+    return this.emit(node.val, node);
+  });
+  use(this);
+}
+
+/**
+ * Prototype methods
+ */
+
+Compiler.prototype = {
+
+  /**
+   * Throw an error message with details including the cursor position.
+   * @param {String} `msg` Message to use in the Error.
+   */
+
+  error: function(msg, node) {
+    var pos = node.position || {start: {column: 0}};
+    var message = this.options.source + ' column:' + pos.start.column + ': ' + msg;
+
+    var err = new Error(message);
+    err.reason = msg;
+    err.column = pos.start.column;
+    err.source = this.pattern;
+
+    if (this.options.silent) {
+      this.errors.push(err);
+    } else {
+      throw err;
+    }
+  },
+
+  /**
+   * Define a non-enumberable property on the `Compiler` instance.
+   *
+   * ```js
+   * compiler.define('foo', 'bar');
+   * ```
+   * @name .define
+   * @param {String} `key` propery name
+   * @param {any} `val` property value
+   * @return {Object} Returns the Compiler instance for chaining.
+   * @api public
+   */
+
+  define: function(key, val) {
+    define(this, key, val);
+    return this;
+  },
+
+  /**
+   * Emit `node.val`
+   */
+
+  emit: function(str, node) {
+    this.output += str;
+    return str;
+  },
+
+  /**
+   * Add a compiler `fn` with the given `name`
+   */
+
+  set: function(name, fn) {
+    this.compilers[name] = fn;
+    return this;
+  },
+
+  /**
+   * Get compiler `name`.
+   */
+
+  get: function(name) {
+    return this.compilers[name];
+  },
+
+  /**
+   * Get the previous AST node.
+   */
+
+  prev: function(n) {
+    return this.ast.nodes[this.idx - (n || 1)] || { type: 'bos', val: '' };
+  },
+
+  /**
+   * Get the next AST node.
+   */
+
+  next: function(n) {
+    return this.ast.nodes[this.idx + (n || 1)] || { type: 'eos', val: '' };
+  },
+
+  /**
+   * Visit `node`.
+   */
+
+  visit: function(node, nodes, i) {
+    var fn = this.compilers[node.type];
+    this.idx = i;
+
+    if (typeof fn !== 'function') {
+      throw this.error('compiler "' + node.type + '" is not registered', node);
+    }
+    return fn.call(this, node, nodes, i);
+  },
+
+  /**
+   * Map visit over array of `nodes`.
+   */
+
+  mapVisit: function(nodes) {
+    if (!Array.isArray(nodes)) {
+      throw new TypeError('expected an array');
+    }
+    var len = nodes.length;
+    var idx = -1;
+    while (++idx < len) {
+      this.visit(nodes[idx], nodes, idx);
+    }
+    return this;
+  },
+
+  /**
+   * Compile `ast`.
+   */
+
+  compile: function(ast, options) {
+    var opts = utils.extend({}, this.options, options);
+    this.ast = ast;
+    this.parsingErrors = this.ast.errors;
+    this.output = '';
+
+    // source map support
+    if (opts.sourcemap) {
+      var sourcemaps = require('./source-maps');
+      sourcemaps(this);
+      this.mapVisit(this.ast.nodes);
+      this.applySourceMaps();
+      this.map = opts.sourcemap === 'generator' ? this.map : this.map.toJSON();
+      return this;
+    }
+
+    this.mapVisit(this.ast.nodes);
+    return this;
+  }
+};
+
+/**
+ * Expose `Compiler`
+ */
+
+module.exports = Compiler;

node_modules/snapdragon/lib/parser.js

@@ -0,0 +1,533 @@
+'use strict';
+
+var use = require('use');
+var util = require('util');
+var Cache = require('map-cache');
+var define = require('define-property');
+var debug = require('debug')('snapdragon:parser');
+var Position = require('./position');
+var utils = require('./utils');
+
+/**
+ * Create a new `Parser` with the given `input` and `options`.
+ * @param {String} `input`
+ * @param {Object} `options`
+ * @api public
+ */
+
+function Parser(options) {
+  debug('initializing', __filename);
+  this.options = utils.extend({source: 'string'}, options);
+  this.init(this.options);
+  use(this);
+}
+
+/**
+ * Prototype methods
+ */
+
+Parser.prototype = {
+  constructor: Parser,
+
+  init: function(options) {
+    this.orig = '';
+    this.input = '';
+    this.parsed = '';
+
+    this.column = 1;
+    this.line = 1;
+
+    this.regex = new Cache();
+    this.errors = this.errors || [];
+    this.parsers = this.parsers || {};
+    this.types = this.types || [];
+    this.sets = this.sets || {};
+    this.fns = this.fns || [];
+    this.currentType = 'root';
+
+    var pos = this.position();
+    this.bos = pos({type: 'bos', val: ''});
+
+    this.ast = {
+      type: 'root',
+      errors: this.errors,
+      nodes: [this.bos]
+    };
+
+    define(this.bos, 'parent', this.ast);
+    this.nodes = [this.ast];
+
+    this.count = 0;
+    this.setCount = 0;
+    this.stack = [];
+  },
+
+  /**
+   * Throw a formatted error with the cursor column and `msg`.
+   * @param {String} `msg` Message to use in the Error.
+   */
+
+  error: function(msg, node) {
+    var pos = node.position || {start: {column: 0, line: 0}};
+    var line = pos.start.line;
+    var column = pos.start.column;
+    var source = this.options.source;
+
+    var message = source + ' <line:' + line + ' column:' + column + '>: ' + msg;
+    var err = new Error(message);
+    err.source = source;
+    err.reason = msg;
+    err.pos = pos;
+
+    if (this.options.silent) {
+      this.errors.push(err);
+    } else {
+      throw err;
+    }
+  },
+
+  /**
+   * Define a non-enumberable property on the `Parser` instance.
+   *
+   * ```js
+   * parser.define('foo', 'bar');
+   * ```
+   * @name .define
+   * @param {String} `key` propery name
+   * @param {any} `val` property value
+   * @return {Object} Returns the Parser instance for chaining.
+   * @api public
+   */
+
+  define: function(key, val) {
+    define(this, key, val);
+    return this;
+  },
+
+  /**
+   * Mark position and patch `node.position`.
+   */
+
+  position: function() {
+    var start = { line: this.line, column: this.column };
+    var self = this;
+
+    return function(node) {
+      define(node, 'position', new Position(start, self));
+      return node;
+    };
+  },
+
+  /**
+   * Set parser `name` with the given `fn`
+   * @param {String} `name`
+   * @param {Function} `fn`
+   * @api public
+   */
+
+  set: function(type, fn) {
+    if (this.types.indexOf(type) === -1) {
+      this.types.push(type);
+    }
+    this.parsers[type] = fn.bind(this);
+    return this;
+  },
+
+  /**
+   * Get parser `name`
+   * @param {String} `name`
+   * @api public
+   */
+
+  get: function(name) {
+    return this.parsers[name];
+  },
+
+  /**
+   * Push a `token` onto the `type` stack.
+   *
+   * @param {String} `type`
+   * @return {Object} `token`
+   * @api public
+   */
+
+  push: function(type, token) {
+    this.sets[type] = this.sets[type] || [];
+    this.count++;
+    this.stack.push(token);
+    return this.sets[type].push(token);
+  },
+
+  /**
+   * Pop a token off of the `type` stack
+   * @param {String} `type`
+   * @returns {Object} Returns a token
+   * @api public
+   */
+
+  pop: function(type) {
+    this.sets[type] = this.sets[type] || [];
+    this.count--;
+    this.stack.pop();
+    return this.sets[type].pop();
+  },
+
+  /**
+   * Return true if inside a `stack` node. Types are `braces`, `parens` or `brackets`.
+   *
+   * @param {String} `type`
+   * @return {Boolean}
+   * @api public
+   */
+
+  isInside: function(type) {
+    this.sets[type] = this.sets[type] || [];
+    return this.sets[type].length > 0;
+  },
+
+  /**
+   * Return true if `node` is the given `type`.
+   *
+   * ```js
+   * parser.isType(node, 'brace');
+   * ```
+   * @param {Object} `node`
+   * @param {String} `type`
+   * @return {Boolean}
+   * @api public
+   */
+
+  isType: function(node, type) {
+    return node && node.type === type;
+  },
+
+  /**
+   * Get the previous AST node
+   * @return {Object}
+   */
+
+  prev: function(n) {
+    return this.stack.length > 0
+      ? utils.last(this.stack, n)
+      : utils.last(this.nodes, n);
+  },
+
+  /**
+   * Update line and column based on `str`.
+   */
+
+  consume: function(len) {
+    this.input = this.input.substr(len);
+  },
+
+  /**
+   * Update column based on `str`.
+   */
+
+  updatePosition: function(str, len) {
+    var lines = str.match(/\n/g);
+    if (lines) this.line += lines.length;
+    var i = str.lastIndexOf('\n');
+    this.column = ~i ? len - i : this.column + len;
+    this.parsed += str;
+    this.consume(len);
+  },
+
+  /**
+   * Match `regex`, return captures, and update the cursor position by `match[0]` length.
+   * @param {RegExp} `regex`
+   * @return {Object}
+   */
+
+  match: function(regex) {
+    var m = regex.exec(this.input);
+    if (m) {
+      this.updatePosition(m[0], m[0].length);
+      return m;
+    }
+  },
+
+  /**
+   * Capture `type` with the given regex.
+   * @param {String} `type`
+   * @param {RegExp} `regex`
+   * @return {Function}
+   */
+
+  capture: function(type, regex) {
+    if (typeof regex === 'function') {
+      return this.set.apply(this, arguments);
+    }
+
+    this.regex.set(type, regex);
+    this.set(type, function() {
+      var parsed = this.parsed;
+      var pos = this.position();
+      var m = this.match(regex);
+      if (!m || !m[0]) return;
+
+      var prev = this.prev();
+      var node = pos({
+        type: type,
+        val: m[0],
+        parsed: parsed,
+        rest: this.input
+      });
+
+      if (m[1]) {
+        node.inner = m[1];
+      }
+
+      define(node, 'inside', this.stack.length > 0);
+      define(node, 'parent', prev);
+      prev.nodes.push(node);
+    }.bind(this));
+    return this;
+  },
+
+  /**
+   * Create a parser with open and close for parens,
+   * brackets or braces
+   */
+
+  capturePair: function(type, openRegex, closeRegex, fn) {
+    this.sets[type] = this.sets[type] || [];
+
+    /**
+     * Open
+     */
+
+    this.set(type + '.open', function() {
+      var parsed = this.parsed;
+      var pos = this.position();
+      var m = this.match(openRegex);
+      if (!m || !m[0]) return;
+
+      var val = m[0];
+      this.setCount++;
+      this.specialChars = true;
+      var open = pos({
+        type: type + '.open',
+        val: val,
+        rest: this.input
+      });
+
+      if (typeof m[1] !== 'undefined') {
+        open.inner = m[1];
+      }
+
+      var prev = this.prev();
+      var node = pos({
+        type: type,
+        nodes: [open]
+      });
+
+      define(node, 'rest', this.input);
+      define(node, 'parsed', parsed);
+      define(node, 'prefix', m[1]);
+      define(node, 'parent', prev);
+      define(open, 'parent', node);
+
+      if (typeof fn === 'function') {
+        fn.call(this, open, node);
+      }
+
+      this.push(type, node);
+      prev.nodes.push(node);
+    });
+
+    /**
+     * Close
+     */
+
+    this.set(type + '.close', function() {
+      var pos = this.position();
+      var m = this.match(closeRegex);
+      if (!m || !m[0]) return;
+
+      var parent = this.pop(type);
+      var node = pos({
+        type: type + '.close',
+        rest: this.input,
+        suffix: m[1],
+        val: m[0]
+      });
+
+      if (!this.isType(parent, type)) {
+        if (this.options.strict) {
+          throw new Error('missing opening "' + type + '"');
+        }
+
+        this.setCount--;
+        node.escaped = true;
+        return node;
+      }
+
+      if (node.suffix === '\\') {
+        parent.escaped = true;
+        node.escaped = true;
+      }
+
+      parent.nodes.push(node);
+      define(node, 'parent', parent);
+    });
+
+    return this;
+  },
+
+  /**
+   * Capture end-of-string
+   */
+
+  eos: function() {
+    var pos = this.position();
+    if (this.input) return;
+    var prev = this.prev();
+
+    while (prev.type !== 'root' && !prev.visited) {
+      if (this.options.strict === true) {
+        throw new SyntaxError('invalid syntax:' + util.inspect(prev, null, 2));
+      }
+
+      if (!hasDelims(prev)) {
+        prev.parent.escaped = true;
+        prev.escaped = true;
+      }
+
+      visit(prev, function(node) {
+        if (!hasDelims(node.parent)) {
+          node.parent.escaped = true;
+          node.escaped = true;
+        }
+      });
+
+      prev = prev.parent;
+    }
+
+    var tok = pos({
+      type: 'eos',
+      val: this.append || ''
+    });
+
+    define(tok, 'parent', this.ast);
+    return tok;
+  },
+
+  /**
+   * Run parsers to advance the cursor position
+   */
+
+  next: function() {
+    var parsed = this.parsed;
+    var len = this.types.length;
+    var idx = -1;
+    var tok;
+
+    while (++idx < len) {
+      if ((tok = this.parsers[this.types[idx]].call(this))) {
+        define(tok, 'rest', this.input);
+        define(tok, 'parsed', parsed);
+        this.last = tok;
+        return tok;
+      }
+    }
+  },
+
+  /**
+   * Parse the given string.
+   * @return {Array}
+   */
+
+  parse: function(input) {
+    if (typeof input !== 'string') {
+      throw new TypeError('expected a string');
+    }
+
+    this.init(this.options);
+    this.orig = input;
+    this.input = input;
+    var self = this;
+
+    function parse() {
+      // check input before calling `.next()`
+      input = self.input;
+
+      // get the next AST ndoe
+      var node = self.next();
+      if (node) {
+        var prev = self.prev();
+        if (prev) {
+          define(node, 'parent', prev);
+          if (prev.nodes) {
+            prev.nodes.push(node);
+          }
+        }
+
+        if (self.sets.hasOwnProperty(prev.type)) {
+          self.currentType = prev.type;
+        }
+      }
+
+      // if we got here but input is not changed, throw an error
+      if (self.input && input === self.input) {
+        throw new Error('no parsers registered for: "' + self.input.slice(0, 5) + '"');
+      }
+    }
+
+    while (this.input) parse();
+    if (this.stack.length && this.options.strict) {
+      var node = this.stack.pop();
+      throw this.error('missing opening ' + node.type + ': "' + this.orig + '"');
+    }
+
+    var eos = this.eos();
+    var tok = this.prev();
+    if (tok.type !== 'eos') {
+      this.ast.nodes.push(eos);
+    }
+
+    return this.ast;
+  }
+};
+
+/**
+ * Visit `node` with the given `fn`
+ */
+
+function visit(node, fn) {
+  if (!node.visited) {
+    define(node, 'visited', true);
+    return node.nodes ? mapVisit(node.nodes, fn) : fn(node);
+  }
+  return node;
+}
+
+/**
+ * Map visit over array of `nodes`.
+ */
+
+function mapVisit(nodes, fn) {
+  var len = nodes.length;
+  var idx = -1;
+  while (++idx < len) {
+    visit(nodes[idx], fn);
+  }
+}
+
+function hasOpen(node) {
+  return node.nodes && node.nodes[0].type === (node.type + '.open');
+}
+
+function hasClose(node) {
+  return node.nodes && utils.last(node.nodes).type === (node.type + '.close');
+}
+
+function hasDelims(node) {
+  return hasOpen(node) && hasClose(node);
+}
+
+/**
+ * Expose `Parser`
+ */
+
+module.exports = Parser;

node_modules/snapdragon/lib/position.js

@@ -0,0 +1,14 @@
+'use strict';
+
+var define = require('define-property');
+
+/**
+ * Store position for a node
+ */
+
+module.exports = function Position(start, parser) {
+  this.start = start;
+  this.end = { line: parser.line, column: parser.column };
+  define(this, 'content', parser.orig);
+  define(this, 'source', parser.options.source);
+};

node_modules/snapdragon/lib/source-maps.js

@@ -0,0 +1,145 @@
+'use strict';
+
+var fs = require('fs');
+var path = require('path');
+var define = require('define-property');
+var utils = require('./utils');
+
+/**
+ * Expose `mixin()`.
+ * This code is based on `source-maps-support.js` in reworkcss/css
+ * https://github.com/reworkcss/css/blob/master/lib/stringify/source-map-support.js
+ * Copyright (c) 2012 TJ Holowaychuk <tj@vision-media.ca>
+ */
+
+module.exports = mixin;
+
+/**
+ * Mixin source map support into `compiler`.
+ *
+ * @param {Object} `compiler`
+ * @api public
+ */
+
+function mixin(compiler) {
+  define(compiler, '_comment', compiler.comment);
+  compiler.map = new utils.SourceMap.SourceMapGenerator();
+  compiler.position = { line: 1, column: 1 };
+  compiler.content = {};
+  compiler.files = {};
+
+  for (var key in exports) {
+    define(compiler, key, exports[key]);
+  }
+}
+
+/**
+ * Update position.
+ *
+ * @param {String} str
+ */
+
+exports.updatePosition = function(str) {
+  var lines = str.match(/\n/g);
+  if (lines) this.position.line += lines.length;
+  var i = str.lastIndexOf('\n');
+  this.position.column = ~i ? str.length - i : this.position.column + str.length;
+};
+
+/**
+ * Emit `str` with `position`.
+ *
+ * @param {String} str
+ * @param {Object} [pos]
+ * @return {String}
+ */
+
+exports.emit = function(str, node) {
+  var position = node.position || {};
+  var source = position.source;
+  if (source) {
+    if (position.filepath) {
+      source = utils.unixify(position.filepath);
+    }
+
+    this.map.addMapping({
+      source: source,
+      generated: {
+        line: this.position.line,
+        column: Math.max(this.position.column - 1, 0)
+      },
+      original: {
+        line: position.start.line,
+        column: position.start.column - 1
+      }
+    });
+
+    if (position.content) {
+      this.addContent(source, position);
+    }
+    if (position.filepath) {
+      this.addFile(source, position);
+    }
+
+    this.updatePosition(str);
+    this.output += str;
+  }
+  return str;
+};
+
+/**
+ * Adds a file to the source map output if it has not already been added
+ * @param {String} `file`
+ * @param {Object} `pos`
+ */
+
+exports.addFile = function(file, position) {
+  if (typeof position.content !== 'string') return;
+  if (Object.prototype.hasOwnProperty.call(this.files, file)) return;
+  this.files[file] = position.content;
+};
+
+/**
+ * Adds a content source to the source map output if it has not already been added
+ * @param {String} `source`
+ * @param {Object} `position`
+ */
+
+exports.addContent = function(source, position) {
+  if (typeof position.content !== 'string') return;
+  if (Object.prototype.hasOwnProperty.call(this.content, source)) return;
+  this.map.setSourceContent(source, position.content);
+};
+
+/**
+ * Applies any original source maps to the output and embeds the source file
+ * contents in the source map.
+ */
+
+exports.applySourceMaps = function() {
+  Object.keys(this.files).forEach(function(file) {
+    var content = this.files[file];
+    this.map.setSourceContent(file, content);
+
+    if (this.options.inputSourcemaps === true) {
+      var originalMap = utils.sourceMapResolve.resolveSync(content, file, fs.readFileSync);
+      if (originalMap) {
+        var map = new utils.SourceMap.SourceMapConsumer(originalMap.map);
+        var relativeTo = originalMap.sourcesRelativeTo;
+        this.map.applySourceMap(map, file, utils.unixify(path.dirname(relativeTo)));
+      }
+    }
+  }, this);
+};
+
+/**
+ * Process comments, drops sourceMap comments.
+ * @param {Object} node
+ */
+
+exports.comment = function(node) {
+  if (/^# sourceMappingURL=/.test(node.comment)) {
+    return this.emit('', node.position);
+  }
+  return this._comment(node);
+};

node_modules/snapdragon/lib/utils.js

@@ -0,0 +1,48 @@
+'use strict';
+
+/**
+ * Module dependencies
+ */
+
+exports.extend = require('extend-shallow');
+exports.SourceMap = require('source-map');
+exports.sourceMapResolve = require('source-map-resolve');
+
+/**
+ * Convert backslash in the given string to forward slashes
+ */
+
+exports.unixify = function(fp) {
+  return fp.split(/\\+/).join('/');
+};
+
+/**
+ * Return true if `val` is a non-empty string
+ *
+ * @param {String} `str`
+ * @return {Boolean}
+ */
+
+exports.isString = function(str) {
+  return str && typeof str === 'string';
+};
+
+/**
+ * Cast `val` to an array
+ * @return {Array}
+ */
+
+exports.arrayify = function(val) {
+  if (typeof val === 'string') return [val];
+  return val ? (Array.isArray(val) ? val : [val]) : [];
+};
+
+/**
+ * Get the last `n` element from the given `array`
+ * @param {Array} `array`
+ * @return {*}
+ */
+
+exports.last = function(arr, n) {
+  return arr[arr.length - (n || 1)];
+};

node_modules/snapdragon/node_modules/debug/.coveralls.yml

@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve

node_modules/snapdragon/node_modules/debug/.eslintrc

@@ -0,0 +1,11 @@
+{
+  "env": {
+    "browser": true,
+    "node": true
+  },
+  "rules": {
+    "no-console": 0,
+    "no-empty": [1, { "allowEmptyCatch": true }]
+  },
+  "extends": "eslint:recommended"
+}

node_modules/snapdragon/node_modules/debug/.npmignore

@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json

node_modules/snapdragon/node_modules/debug/.travis.yml

@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+  - "6"
+  - "5"
+  - "4"
+
+install:
+  - make node_modules
+
+script:
+  - make lint
+  - make test
+  - make coveralls

node_modules/snapdragon/node_modules/debug/CHANGELOG.md

@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release

node_modules/snapdragon/node_modules/debug/LICENSE

@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

node_modules/snapdragon/node_modules/debug/Makefile

@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+	@NODE_ENV= $(PKG) install
+	@touch node_modules
+
+lint: .FORCE
+	eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+	mkdir -p dist
+
+	@$(BROWSERIFY) \
+		--standalone debug \
+		. > dist/debug.js
+
+	karma start --single-run
+	rimraf dist
+
+test: .FORCE
+	concurrently \
+		"make test-node" \
+		"make test-browser"
+
+coveralls:
+	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean

node_modules/snapdragon/node_modules/debug/README.md

@@ -0,0 +1,312 @@
+# debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+  debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+
+  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+  ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+
+  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
+
+## Conventions
+
+  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+  When running through Node.js, you can set a few environment variables that will
+  change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+  __Note:__ The environment variables beginning with `DEBUG_` end up being
+  converted into an Options object that gets used with `%o`/`%O` formatters.
+  See the Node.js documentation for
+  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+  for the complete list.
+
+## Formatters
+
+
+  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+  if you don't want to build it yourself.
+
+  Debug's enable state is currently persisted by `localStorage`.
+  Consider the situation shown below where you have `worker:a` and `worker:b`,
+  and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+  option. These are WebKit web inspectors, Firefox ([since version
+  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+  and the Firebug plugin for Firefox (any version).
+
+  Colored output looks something like:
+
+  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
+
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ 
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

node_modules/snapdragon/node_modules/debug/component.json

@@ -0,0 +1,19 @@
+{
+  "name": "debug",
+  "repo": "visionmedia/debug",
+  "description": "small debugging utility",
+  "version": "2.6.9",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "main": "src/browser.js",
+  "scripts": [
+    "src/browser.js",
+    "src/debug.js"
+  ],
+  "dependencies": {
+    "rauchg/ms.js": "0.7.1"
+  }
+}

node_modules/snapdragon/node_modules/debug/karma.conf.js

@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+  config.set({
+
+    // base path that will be used to resolve all patterns (eg. files, exclude)
+    basePath: '',
+
+
+    // frameworks to use
+    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+    frameworks: ['mocha', 'chai', 'sinon'],
+
+
+    // list of files / patterns to load in the browser
+    files: [
+      'dist/debug.js',
+      'test/*spec.js'
+    ],
+
+
+    // list of files to exclude
+    exclude: [
+      'src/node.js'
+    ],
+
+
+    // preprocess matching files before serving them to the browser
+    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+    preprocessors: {
+    },
+
+    // test results reporter to use
+    // possible values: 'dots', 'progress'
+    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+    reporters: ['progress'],
+
+
+    // web server port
+    port: 9876,
+
+
+    // enable / disable colors in the output (reporters and logs)
+    colors: true,
+
+
+    // level of logging
+    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+    logLevel: config.LOG_INFO,
+
+
+    // enable / disable watching file and executing tests whenever any file changes
+    autoWatch: true,
+
+
+    // start these browsers
+    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+    browsers: ['PhantomJS'],
+
+
+    // Continuous Integration mode
+    // if true, Karma captures browsers, runs the tests and exits
+    singleRun: false,
+
+    // Concurrency level
+    // how many browser should be started simultaneous
+    concurrency: Infinity
+  })
+}

node_modules/snapdragon/node_modules/debug/node.js

@@ -0,0 +1 @@
+module.exports = require('./src/node');

node_modules/snapdragon/node_modules/debug/package.json

@@ -0,0 +1,49 @@
+{
+  "name": "debug",
+  "version": "2.6.9",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/debug.git"
+  },
+  "description": "small debugging utility",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "author": "TJ Holowaychuk <tj@vision-media.ca>",
+  "contributors": [
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ],
+  "license": "MIT",
+  "dependencies": {
+    "ms": "2.0.0"
+  },
+  "devDependencies": {
+    "browserify": "9.0.3",
+    "chai": "^3.5.0",
+    "concurrently": "^3.1.0",
+    "coveralls": "^2.11.15",
+    "eslint": "^3.12.1",
+    "istanbul": "^0.4.5",
+    "karma": "^1.3.0",
+    "karma-chai": "^0.1.0",
+    "karma-mocha": "^1.3.0",
+    "karma-phantomjs-launcher": "^1.0.2",
+    "karma-sinon": "^1.0.5",
+    "mocha": "^3.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "rimraf": "^2.5.4",
+    "sinon": "^1.17.6",
+    "sinon-chai": "^2.8.0"
+  },
+  "main": "./src/index.js",
+  "browser": "./src/browser.js",
+  "component": {
+    "scripts": {
+      "debug/index.js": "browser.js",
+      "debug/debug.js": "debug.js"
+    }
+  }
+}

node_modules/snapdragon/node_modules/debug/src/browser.js

@@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+               && 'undefined' != typeof chrome.storage
+                  ? chrome.storage.local
+                  : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+  'lightseagreen',
+  'forestgreen',
+  'goldenrod',
+  'dodgerblue',
+  'darkorchid',
+  'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+    return true;
+  }
+
+  // is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+  return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+    // is firebug? http://stackoverflow.com/a/398120/376773
+    (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+    // is firefox >= v31?
+    // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+    // double check webkit in userAgent just in case we are in a worker
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+  try {
+    return JSON.stringify(v);
+  } catch (err) {
+    return '[UnexpectedJSONParseError]: ' + err.message;
+  }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var useColors = this.useColors;
+
+  args[0] = (useColors ? '%c' : '')
+    + this.namespace
+    + (useColors ? ' %c' : ' ')
+    + args[0]
+    + (useColors ? '%c ' : ' ')
+    + '+' + exports.humanize(this.diff);
+
+  if (!useColors) return;
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit')
+
+  // the final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function(match) {
+    if ('%%' === match) return;
+    index++;
+    if ('%c' === match) {
+      // we only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+
+  args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+  // this hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return 'object' === typeof console
+    && console.log
+    && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  try {
+    if (null == namespaces) {
+      exports.storage.removeItem('debug');
+    } else {
+      exports.storage.debug = namespaces;
+    }
+  } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  var r;
+  try {
+    r = exports.storage.debug;
+  } catch(e) {}
+
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+  try {
+    return window.localStorage;
+  } catch (e) {}
+}

node_modules/snapdragon/node_modules/debug/src/debug.js

@@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+  var hash = 0, i;
+
+  for (i in namespace) {
+    hash  = ((hash << 5) - hash) + namespace.charCodeAt(i);
+    hash |= 0; // Convert to 32bit integer
+  }
+
+  return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+  function debug() {
+    // disabled?
+    if (!debug.enabled) return;
+
+    var self = debug;
+
+    // set `diff` timestamp
+    var curr = +new Date();
+    var ms = curr - (prevTime || curr);
+    self.diff = ms;
+    self.prev = prevTime;
+    self.curr = curr;
+    prevTime = curr;
+
+    // turn the `arguments` into a proper Array
+    var args = new Array(arguments.length);
+    for (var i = 0; i < args.length; i++) {
+      args[i] = arguments[i];
+    }
+
+    args[0] = exports.coerce(args[0]);
+
+    if ('string' !== typeof args[0]) {
+      // anything else let's inspect with %O
+      args.unshift('%O');
+    }
+
+    // apply any `formatters` transformations
+    var index = 0;
+    args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+      // if we encounter an escaped % then don't increase the array index
+      if (match === '%%') return match;
+      index++;
+      var formatter = exports.formatters[format];
+      if ('function' === typeof formatter) {
+        var val = args[index];
+        match = formatter.call(self, val);
+
+        // now we need to remove `args[index]` since it's inlined in the `format`
+        args.splice(index, 1);
+        index--;
+      }
+      return match;
+    });
+
+    // apply env-specific formatting (colors, etc.)
+    exports.formatArgs.call(self, args);
+
+    var logFn = debug.log || exports.log || console.log.bind(console);
+    logFn.apply(self, args);
+  }
+
+  debug.namespace = namespace;
+  debug.enabled = exports.enabled(namespace);
+  debug.useColors = exports.useColors();
+  debug.color = selectColor(namespace);
+
+  // env-specific initialization logic for debug instances
+  if ('function' === typeof exports.init) {
+    exports.init(debug);
+  }
+
+  return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+  exports.save(namespaces);
+
+  exports.names = [];
+  exports.skips = [];
+
+  var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+  var len = split.length;
+
+  for (var i = 0; i < len; i++) {
+    if (!split[i]) continue; // ignore empty strings
+    namespaces = split[i].replace(/\*/g, '.*?');
+    if (namespaces[0] === '-') {
+      exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+    } else {
+      exports.names.push(new RegExp('^' + namespaces + '$'));
+    }
+  }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+  exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+  var i, len;
+  for (i = 0, len = exports.skips.length; i < len; i++) {
+    if (exports.skips[i].test(name)) {
+      return false;
+    }
+  }
+  for (i = 0, len = exports.names.length; i < len; i++) {
+    if (exports.names[i].test(name)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+  if (val instanceof Error) return val.stack || val.message;
+  return val;
+}

node_modules/snapdragon/node_modules/debug/src/index.js

@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+  module.exports = require('./browser.js');
+} else {
+  module.exports = require('./node.js');
+}

node_modules/snapdragon/node_modules/debug/src/inspector-log.js

@@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+  const stdout = console._stdout;
+  console._stdout = nullStream;
+  console.log.apply(console, arguments);
+  console._stdout = stdout;
+}

node_modules/snapdragon/node_modules/debug/src/node.js

@@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+  return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+  // camel-case
+  var prop = key
+    .substring(6)
+    .toLowerCase()
+    .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+  // coerce string value into JS value
+  var val = process.env[key];
+  if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+  else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+  else if (val === 'null') val = null;
+  else val = Number(val);
+
+  obj[prop] = val;
+  return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ *   $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+  util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+             2 === fd ? process.stderr :
+             createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  return 'colors' in exports.inspectOpts
+    ? Boolean(exports.inspectOpts.colors)
+    : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts)
+    .split('\n').map(function(str) {
+      return str.trim()
+    }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var name = this.namespace;
+  var useColors = this.useColors;
+
+  if (useColors) {
+    var c = this.color;
+    var prefix = '  \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+    args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+    args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+  } else {
+    args[0] = new Date().toUTCString()
+      + ' ' + name + ' ' + args[0];
+  }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+  return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  if (null == namespaces) {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  } else {
+    process.env.DEBUG = namespaces;
+  }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+  var stream;
+  var tty_wrap = process.binding('tty_wrap');
+
+  // Note stream._type is used for test-module-load-list.js
+
+  switch (tty_wrap.guessHandleType(fd)) {
+    case 'TTY':
+      stream = new tty.WriteStream(fd);
+      stream._type = 'tty';
+
+      // Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    case 'FILE':
+      var fs = require('fs');
+      stream = new fs.SyncWriteStream(fd, { autoClose: false });
+      stream._type = 'fs';
+      break;
+
+    case 'PIPE':
+    case 'TCP':
+      var net = require('net');
+      stream = new net.Socket({
+        fd: fd,
+        readable: false,
+        writable: true
+      });
+
+      // FIXME Should probably have an option in net.Socket to create a
+      // stream from an existing fd which is writable only. But for now
+      // we'll just add this hack and set the `readable` member to false.
+      // Test: ./node test/fixtures/echo.js < /etc/passwd
+      stream.readable = false;
+      stream.read = null;
+      stream._type = 'pipe';
+
+      // FIXME Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    default:
+      // Probably an error on in uv_guess_handle()
+      throw new Error('Implement me. Unknown stream file type!');
+  }
+
+  // For supporting legacy API we put the FD here.
+  stream.fd = fd;
+
+  stream._isStdio = true;
+
+  return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+  debug.inspectOpts = {};
+
+  var keys = Object.keys(exports.inspectOpts);
+  for (var i = 0; i < keys.length; i++) {
+    debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+  }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());

node_modules/snapdragon/node_modules/ms/index.js

@@ -0,0 +1,152 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isNaN(val) === false) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  if (ms >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (ms >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (ms >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (ms >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  return plural(ms, d, 'day') ||
+    plural(ms, h, 'hour') ||
+    plural(ms, m, 'minute') ||
+    plural(ms, s, 'second') ||
+    ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+  if (ms < n) {
+    return;
+  }
+  if (ms < n * 1.5) {
+    return Math.floor(ms / n) + ' ' + name;
+  }
+  return Math.ceil(ms / n) + ' ' + name + 's';
+}

node_modules/snapdragon/node_modules/ms/license.md

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Zeit, Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

node_modules/snapdragon/node_modules/ms/package.json

@@ -0,0 +1,37 @@
+{
+  "name": "ms",
+  "version": "2.0.0",
+  "description": "Tiny milisecond conversion utility",
+  "repository": "zeit/ms",
+  "main": "./index",
+  "files": [
+    "index.js"
+  ],
+  "scripts": {
+    "precommit": "lint-staged",
+    "lint": "eslint lib/* bin/*",
+    "test": "mocha tests.js"
+  },
+  "eslintConfig": {
+    "extends": "eslint:recommended",
+    "env": {
+      "node": true,
+      "es6": true
+    }
+  },
+  "lint-staged": {
+    "*.js": [
+      "npm run lint",
+      "prettier --single-quote --write",
+      "git add"
+    ]
+  },
+  "license": "MIT",
+  "devDependencies": {
+    "eslint": "3.19.0",
+    "expect.js": "0.3.1",
+    "husky": "0.13.3",
+    "lint-staged": "3.4.1",
+    "mocha": "3.4.1"
+  }
+}

node_modules/snapdragon/node_modules/ms/readme.md

@@ -0,0 +1,51 @@
+# ms
+
+[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms)
+[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/)
+
+Use this package to easily convert various time formats to milliseconds.
+
+## Examples
+
+```js
+ms('2 days')  // 172800000
+ms('1d')      // 86400000
+ms('10h')     // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h')      // 7200000
+ms('1m')      // 60000
+ms('5s')      // 5000
+ms('1y')      // 31557600000
+ms('100')     // 100
+```
+
+### Convert from milliseconds
+
+```js
+ms(60000)             // "1m"
+ms(2 * 60000)         // "2m"
+ms(ms('10 hours'))    // "10h"
+```
+
+### Time format written-out
+
+```js
+ms(60000, { long: true })             // "1 minute"
+ms(2 * 60000, { long: true })         // "2 minutes"
+ms(ms('10 hours'), { long: true })    // "10 hours"
+```
+
+## Features
+
+- Works both in [node](https://nodejs.org) and in the browser.
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of equivalent ms is returned.
+
+## Caught a bug?
+
+1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device
+2. Link the package to the global module directory: `npm link`
+3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms!
+
+As always, you can run the tests using: `npm test`

node_modules/snapdragon/node_modules/source-map/CHANGELOG.md

@@ -0,0 +1,301 @@
+# Change Log
+
+## 0.5.6
+
+* Fix for regression when people were using numbers as names in source maps. See
+  #236.
+
+## 0.5.5
+
+* Fix "regression" of unsupported, implementation behavior that half the world
+  happens to have come to depend on. See #235.
+
+* Fix regression involving function hoisting in SpiderMonkey. See #233.
+
+## 0.5.4
+
+* Large performance improvements to source-map serialization. See #228 and #229.
+
+## 0.5.3
+
+* Do not include unnecessary distribution files. See
+  commit ef7006f8d1647e0a83fdc60f04f5a7ca54886f86.
+
+## 0.5.2
+
+* Include browser distributions of the library in package.json's `files`. See
+  issue #212.
+
+## 0.5.1
+
+* Fix latent bugs in IndexedSourceMapConsumer.prototype._parseMappings. See
+  ff05274becc9e6e1295ed60f3ea090d31d843379.
+
+## 0.5.0
+
+* Node 0.8 is no longer supported.
+
+* Use webpack instead of dryice for bundling.
+
+* Big speedups serializing source maps. See pull request #203.
+
+* Fix a bug with `SourceMapConsumer.prototype.sourceContentFor` and sources that
+  explicitly start with the source root. See issue #199.
+
+## 0.4.4
+
+* Fix an issue where using a `SourceMapGenerator` after having created a
+  `SourceMapConsumer` from it via `SourceMapConsumer.fromSourceMap` failed. See
+  issue #191.
+
+* Fix an issue with where `SourceMapGenerator` would mistakenly consider
+  different mappings as duplicates of each other and avoid generating them. See
+  issue #192.
+
+## 0.4.3
+
+* A very large number of performance improvements, particularly when parsing
+  source maps. Collectively about 75% of time shaved off of the source map
+  parsing benchmark!
+
+* Fix a bug in `SourceMapConsumer.prototype.allGeneratedPositionsFor` and fuzzy
+  searching in the presence of a column option. See issue #177.
+
+* Fix a bug with joining a source and its source root when the source is above
+  the root. See issue #182.
+
+* Add the `SourceMapConsumer.prototype.hasContentsOfAllSources` method to
+  determine when all sources' contents are inlined into the source map. See
+  issue #190.
+
+## 0.4.2
+
+* Add an `.npmignore` file so that the benchmarks aren't pulled down by
+  dependent projects. Issue #169.
+
+* Add an optional `column` argument to
+  `SourceMapConsumer.prototype.allGeneratedPositionsFor` and better handle lines
+  with no mappings. Issues #172 and #173.
+
+## 0.4.1
+
+* Fix accidentally defining a global variable. #170.
+
+## 0.4.0
+
+* The default direction for fuzzy searching was changed back to its original
+  direction. See #164.
+
+* There is now a `bias` option you can supply to `SourceMapConsumer` to control
+  the fuzzy searching direction. See #167.
+
+* About an 8% speed up in parsing source maps. See #159.
+
+* Added a benchmark for parsing and generating source maps.
+
+## 0.3.0
+
+* Change the default direction that searching for positions fuzzes when there is
+  not an exact match. See #154.
+
+* Support for environments using json2.js for JSON serialization. See #156.
+
+## 0.2.0
+
+* Support for consuming "indexed" source maps which do not have any remote
+  sections. See pull request #127. This introduces a minor backwards
+  incompatibility if you are monkey patching `SourceMapConsumer.prototype`
+  methods.
+
+## 0.1.43
+
+* Performance improvements for `SourceMapGenerator` and `SourceNode`. See issue
+  #148 for some discussion and issues #150, #151, and #152 for implementations.
+
+## 0.1.42
+
+* Fix an issue where `SourceNode`s from different versions of the source-map
+  library couldn't be used in conjunction with each other. See issue #142.
+
+## 0.1.41
+
+* Fix a bug with getting the source content of relative sources with a "./"
+  prefix. See issue #145 and [Bug 1090768](bugzil.la/1090768).
+
+* Add the `SourceMapConsumer.prototype.computeColumnSpans` method to compute the
+  column span of each mapping.
+
+* Add the `SourceMapConsumer.prototype.allGeneratedPositionsFor` method to find
+  all generated positions associated with a given original source and line.
+
+## 0.1.40
+
+* Performance improvements for parsing source maps in SourceMapConsumer.
+
+## 0.1.39
+
+* Fix a bug where setting a source's contents to null before any source content
+  had been set before threw a TypeError. See issue #131.
+
+## 0.1.38
+
+* Fix a bug where finding relative paths from an empty path were creating
+  absolute paths. See issue #129.
+
+## 0.1.37
+
+* Fix a bug where if the source root was an empty string, relative source paths
+  would turn into absolute source paths. Issue #124.
+
+## 0.1.36
+
+* Allow the `names` mapping property to be an empty string. Issue #121.
+
+## 0.1.35
+
+* A third optional parameter was added to `SourceNode.fromStringWithSourceMap`
+  to specify a path that relative sources in the second parameter should be
+  relative to. Issue #105.
+
+* If no file property is given to a `SourceMapGenerator`, then the resulting
+  source map will no longer have a `null` file property. The property will
+  simply not exist. Issue #104.
+
+* Fixed a bug where consecutive newlines were ignored in `SourceNode`s.
+  Issue #116.
+
+## 0.1.34
+
+* Make `SourceNode` work with windows style ("\r\n") newlines. Issue #103.
+
+* Fix bug involving source contents and the
+  `SourceMapGenerator.prototype.applySourceMap`. Issue #100.
+
+## 0.1.33
+
+* Fix some edge cases surrounding path joining and URL resolution.
+
+* Add a third parameter for relative path to
+  `SourceMapGenerator.prototype.applySourceMap`.
+
+* Fix issues with mappings and EOLs.
+
+## 0.1.32
+
+* Fixed a bug where SourceMapConsumer couldn't handle negative relative columns
+  (issue 92).
+
+* Fixed test runner to actually report number of failed tests as its process
+  exit code.
+
+* Fixed a typo when reporting bad mappings (issue 87).
+
+## 0.1.31
+
+* Delay parsing the mappings in SourceMapConsumer until queried for a source
+  location.
+
+* Support Sass source maps (which at the time of writing deviate from the spec
+  in small ways) in SourceMapConsumer.
+
+## 0.1.30
+
+* Do not join source root with a source, when the source is a data URI.
+
+* Extend the test runner to allow running single specific test files at a time.
+
+* Performance improvements in `SourceNode.prototype.walk` and
+  `SourceMapConsumer.prototype.eachMapping`.
+
+* Source map browser builds will now work inside Workers.
+
+* Better error messages when attempting to add an invalid mapping to a
+  `SourceMapGenerator`.
+
+## 0.1.29
+
+* Allow duplicate entries in the `names` and `sources` arrays of source maps
+  (usually from TypeScript) we are parsing. Fixes github issue 72.
+
+## 0.1.28
+
+* Skip duplicate mappings when creating source maps from SourceNode; github
+  issue 75.
+
+## 0.1.27
+
+* Don't throw an error when the `file` property is missing in SourceMapConsumer,
+  we don't use it anyway.
+
+## 0.1.26
+
+* Fix SourceNode.fromStringWithSourceMap for empty maps. Fixes github issue 70.
+
+## 0.1.25
+
+* Make compatible with browserify
+
+## 0.1.24
+
+* Fix issue with absolute paths and `file://` URIs. See
+  https://bugzilla.mozilla.org/show_bug.cgi?id=885597
+
+## 0.1.23
+
+* Fix issue with absolute paths and sourcesContent, github issue 64.
+
+## 0.1.22
+
+* Ignore duplicate mappings in SourceMapGenerator. Fixes github issue 21.
+
+## 0.1.21
+
+* Fixed handling of sources that start with a slash so that they are relative to
+  the source root's host.
+
+## 0.1.20
+
+* Fixed github issue #43: absolute URLs aren't joined with the source root
+  anymore.
+
+## 0.1.19
+
+* Using Travis CI to run tests.
+
+## 0.1.18
+
+* Fixed a bug in the handling of sourceRoot.
+
+## 0.1.17
+
+* Added SourceNode.fromStringWithSourceMap.
+
+## 0.1.16
+
+* Added missing documentation.
+
+* Fixed the generating of empty mappings in SourceNode.
+
+## 0.1.15
+
+* Added SourceMapGenerator.applySourceMap.
+
+## 0.1.14
+
+* The sourceRoot is now handled consistently.
+
+## 0.1.13
+
+* Added SourceMapGenerator.fromSourceMap.
+
+## 0.1.12
+
+* SourceNode now generates empty mappings too.
+
+## 0.1.11
+
+* Added name support to SourceNode.
+
+## 0.1.10
+
+* Added sourcesContent support to the customer and generator.

node_modules/snapdragon/node_modules/source-map/LICENSE

@@ -0,0 +1,28 @@
+
+Copyright (c) 2009-2011, Mozilla Foundation and contributors
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+  list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+  this list of conditions and the following disclaimer in the documentation
+  and/or other materials provided with the distribution.
+
+* Neither the names of the Mozilla Foundation nor the names of project
+  contributors may be used to endorse or promote products derived from this
+  software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

node_modules/snapdragon/node_modules/source-map/README.md

@@ -0,0 +1,729 @@
+# Source Map
+
+[![Build Status](https://travis-ci.org/mozilla/source-map.png?branch=master)](https://travis-ci.org/mozilla/source-map)
+
+[![NPM](https://nodei.co/npm/source-map.png?downloads=true&downloadRank=true)](https://www.npmjs.com/package/source-map)
+
+This is a library to generate and consume the source map format
+[described here][format].
+
+[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit
+
+## Use with Node
+
+    $ npm install source-map
+
+## Use on the Web
+
+    <script src="https://raw.githubusercontent.com/mozilla/source-map/master/dist/source-map.min.js" defer></script>
+
+--------------------------------------------------------------------------------
+
+<!-- `npm run toc` to regenerate the Table of Contents -->
+
+<!-- START doctoc generated TOC please keep comment here to allow auto update -->
+<!-- DON'T EDIT THIS SECTION, INSTEAD RE-RUN doctoc TO UPDATE -->
+## Table of Contents
+
+- [Examples](#examples)
+  - [Consuming a source map](#consuming-a-source-map)
+  - [Generating a source map](#generating-a-source-map)
+    - [With SourceNode (high level API)](#with-sourcenode-high-level-api)
+    - [With SourceMapGenerator (low level API)](#with-sourcemapgenerator-low-level-api)
+- [API](#api)
+  - [SourceMapConsumer](#sourcemapconsumer)
+    - [new SourceMapConsumer(rawSourceMap)](#new-sourcemapconsumerrawsourcemap)
+    - [SourceMapConsumer.prototype.computeColumnSpans()](#sourcemapconsumerprototypecomputecolumnspans)
+    - [SourceMapConsumer.prototype.originalPositionFor(generatedPosition)](#sourcemapconsumerprototypeoriginalpositionforgeneratedposition)
+    - [SourceMapConsumer.prototype.generatedPositionFor(originalPosition)](#sourcemapconsumerprototypegeneratedpositionfororiginalposition)
+    - [SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)](#sourcemapconsumerprototypeallgeneratedpositionsfororiginalposition)
+    - [SourceMapConsumer.prototype.hasContentsOfAllSources()](#sourcemapconsumerprototypehascontentsofallsources)
+    - [SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])](#sourcemapconsumerprototypesourcecontentforsource-returnnullonmissing)
+    - [SourceMapConsumer.prototype.eachMapping(callback, context, order)](#sourcemapconsumerprototypeeachmappingcallback-context-order)
+  - [SourceMapGenerator](#sourcemapgenerator)
+    - [new SourceMapGenerator([startOfSourceMap])](#new-sourcemapgeneratorstartofsourcemap)
+    - [SourceMapGenerator.fromSourceMap(sourceMapConsumer)](#sourcemapgeneratorfromsourcemapsourcemapconsumer)
+    - [SourceMapGenerator.prototype.addMapping(mapping)](#sourcemapgeneratorprototypeaddmappingmapping)
+    - [SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)](#sourcemapgeneratorprototypesetsourcecontentsourcefile-sourcecontent)
+    - [SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])](#sourcemapgeneratorprototypeapplysourcemapsourcemapconsumer-sourcefile-sourcemappath)
+    - [SourceMapGenerator.prototype.toString()](#sourcemapgeneratorprototypetostring)
+  - [SourceNode](#sourcenode)
+    - [new SourceNode([line, column, source[, chunk[, name]]])](#new-sourcenodeline-column-source-chunk-name)
+    - [SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])](#sourcenodefromstringwithsourcemapcode-sourcemapconsumer-relativepath)
+    - [SourceNode.prototype.add(chunk)](#sourcenodeprototypeaddchunk)
+    - [SourceNode.prototype.prepend(chunk)](#sourcenodeprototypeprependchunk)
+    - [SourceNode.prototype.setSourceContent(sourceFile, sourceContent)](#sourcenodeprototypesetsourcecontentsourcefile-sourcecontent)
+    - [SourceNode.prototype.walk(fn)](#sourcenodeprototypewalkfn)
+    - [SourceNode.prototype.walkSourceContents(fn)](#sourcenodeprototypewalksourcecontentsfn)
+    - [SourceNode.prototype.join(sep)](#sourcenodeprototypejoinsep)
+    - [SourceNode.prototype.replaceRight(pattern, replacement)](#sourcenodeprototypereplacerightpattern-replacement)
+    - [SourceNode.prototype.toString()](#sourcenodeprototypetostring)
+    - [SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])](#sourcenodeprototypetostringwithsourcemapstartofsourcemap)
+
+<!-- END doctoc generated TOC please keep comment here to allow auto update -->
+
+## Examples
+
+### Consuming a source map
+
+```js
+var rawSourceMap = {
+  version: 3,
+  file: 'min.js',
+  names: ['bar', 'baz', 'n'],
+  sources: ['one.js', 'two.js'],
+  sourceRoot: 'http://example.com/www/js/',
+  mappings: 'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA'
+};
+
+var smc = new SourceMapConsumer(rawSourceMap);
+
+console.log(smc.sources);
+// [ 'http://example.com/www/js/one.js',
+//   'http://example.com/www/js/two.js' ]
+
+console.log(smc.originalPositionFor({
+  line: 2,
+  column: 28
+}));
+// { source: 'http://example.com/www/js/two.js',
+//   line: 2,
+//   column: 10,
+//   name: 'n' }
+
+console.log(smc.generatedPositionFor({
+  source: 'http://example.com/www/js/two.js',
+  line: 2,
+  column: 10
+}));
+// { line: 2, column: 28 }
+
+smc.eachMapping(function (m) {
+  // ...
+});
+```
+
+### Generating a source map
+
+In depth guide:
+[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/)
+
+#### With SourceNode (high level API)
+
+```js
+function compile(ast) {
+  switch (ast.type) {
+  case 'BinaryExpression':
+    return new SourceNode(
+      ast.location.line,
+      ast.location.column,
+      ast.location.source,
+      [compile(ast.left), " + ", compile(ast.right)]
+    );
+  case 'Literal':
+    return new SourceNode(
+      ast.location.line,
+      ast.location.column,
+      ast.location.source,
+      String(ast.value)
+    );
+  // ...
+  default:
+    throw new Error("Bad AST");
+  }
+}
+
+var ast = parse("40 + 2", "add.js");
+console.log(compile(ast).toStringWithSourceMap({
+  file: 'add.js'
+}));
+// { code: '40 + 2',
+//   map: [object SourceMapGenerator] }
+```
+
+#### With SourceMapGenerator (low level API)
+
+```js
+var map = new SourceMapGenerator({
+  file: "source-mapped.js"
+});
+
+map.addMapping({
+  generated: {
+    line: 10,
+    column: 35
+  },
+  source: "foo.js",
+  original: {
+    line: 33,
+    column: 2
+  },
+  name: "christopher"
+});
+
+console.log(map.toString());
+// '{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}'
+```
+
+## API
+
+Get a reference to the module:
+
+```js
+// Node.js
+var sourceMap = require('source-map');
+
+// Browser builds
+var sourceMap = window.sourceMap;
+
+// Inside Firefox
+const sourceMap = require("devtools/toolkit/sourcemap/source-map.js");
+```
+
+### SourceMapConsumer
+
+A SourceMapConsumer instance represents a parsed source map which we can query
+for information about the original file positions by giving it a file position
+in the generated source.
+
+#### new SourceMapConsumer(rawSourceMap)
+
+The only parameter is the raw source map (either as a string which can be
+`JSON.parse`'d, or an object). According to the spec, source maps have the
+following attributes:
+
+* `version`: Which version of the source map spec this map is following.
+
+* `sources`: An array of URLs to the original source files.
+
+* `names`: An array of identifiers which can be referenced by individual
+  mappings.
+
+* `sourceRoot`: Optional. The URL root from which all sources are relative.
+
+* `sourcesContent`: Optional. An array of contents of the original source files.
+
+* `mappings`: A string of base64 VLQs which contain the actual mappings.
+
+* `file`: Optional. The generated filename this source map is associated with.
+
+```js
+var consumer = new sourceMap.SourceMapConsumer(rawSourceMapJsonData);
+```
+
+#### SourceMapConsumer.prototype.computeColumnSpans()
+
+Compute the last column for each generated mapping. The last column is
+inclusive.
+
+```js
+// Before:
+consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1 },
+//   { line: 2,
+//     column: 10 },
+//   { line: 2,
+//     column: 20 } ]
+
+consumer.computeColumnSpans();
+
+// After:
+consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1,
+//     lastColumn: 9 },
+//   { line: 2,
+//     column: 10,
+//     lastColumn: 19 },
+//   { line: 2,
+//     column: 20,
+//     lastColumn: Infinity } ]
+
+```
+
+#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition)
+
+Returns the original source, line, and column information for the generated
+source's line and column positions provided. The only argument is an object with
+the following properties:
+
+* `line`: The line number in the generated source.
+
+* `column`: The column number in the generated source.
+
+* `bias`: Either `SourceMapConsumer.GREATEST_LOWER_BOUND` or
+  `SourceMapConsumer.LEAST_UPPER_BOUND`. Specifies whether to return the closest
+  element that is smaller than or greater than the one we are searching for,
+  respectively, if the exact element cannot be found.  Defaults to
+  `SourceMapConsumer.GREATEST_LOWER_BOUND`.
+
+and an object is returned with the following properties:
+
+* `source`: The original source file, or null if this information is not
+  available.
+
+* `line`: The line number in the original source, or null if this information is
+  not available.
+
+* `column`: The column number in the original source, or null if this
+  information is not available.
+
+* `name`: The original identifier, or null if this information is not available.
+
+```js
+consumer.originalPositionFor({ line: 2, column: 10 })
+// { source: 'foo.coffee',
+//   line: 2,
+//   column: 2,
+//   name: null }
+
+consumer.originalPositionFor({ line: 99999999999999999, column: 999999999999999 })
+// { source: null,
+//   line: null,
+//   column: null,
+//   name: null }
+```
+
+#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition)
+
+Returns the generated line and column information for the original source,
+line, and column positions provided. The only argument is an object with
+the following properties:
+
+* `source`: The filename of the original source.
+
+* `line`: The line number in the original source.
+
+* `column`: The column number in the original source.
+
+and an object is returned with the following properties:
+
+* `line`: The line number in the generated source, or null.
+
+* `column`: The column number in the generated source, or null.
+
+```js
+consumer.generatedPositionFor({ source: "example.js", line: 2, column: 10 })
+// { line: 1,
+//   column: 56 }
+```
+
+#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)
+
+Returns all generated line and column information for the original source, line,
+and column provided. If no column is provided, returns all mappings
+corresponding to a either the line we are searching for or the next closest line
+that has any mappings. Otherwise, returns all mappings corresponding to the
+given line and either the column we are searching for or the next closest column
+that has any offsets.
+
+The only argument is an object with the following properties:
+
+* `source`: The filename of the original source.
+
+* `line`: The line number in the original source.
+
+* `column`: Optional. The column number in the original source.
+
+and an array of objects is returned, each with the following properties:
+
+* `line`: The line number in the generated source, or null.
+
+* `column`: The column number in the generated source, or null.
+
+```js
+consumer.allGeneratedpositionsfor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1 },
+//   { line: 2,
+//     column: 10 },
+//   { line: 2,
+//     column: 20 } ]
+```
+
+#### SourceMapConsumer.prototype.hasContentsOfAllSources()
+
+Return true if we have the embedded source content for every source listed in
+the source map, false otherwise.
+
+In other words, if this method returns `true`, then
+`consumer.sourceContentFor(s)` will succeed for every source `s` in
+`consumer.sources`.
+
+```js
+// ...
+if (consumer.hasContentsOfAllSources()) {
+  consumerReadyCallback(consumer);
+} else {
+  fetchSources(consumer, consumerReadyCallback);
+}
+// ...
+```
+
+#### SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])
+
+Returns the original source content for the source provided. The only
+argument is the URL of the original source file.
+
+If the source content for the given source is not found, then an error is
+thrown. Optionally, pass `true` as the second param to have `null` returned
+instead.
+
+```js
+consumer.sources
+// [ "my-cool-lib.clj" ]
+
+consumer.sourceContentFor("my-cool-lib.clj")
+// "..."
+
+consumer.sourceContentFor("this is not in the source map");
+// Error: "this is not in the source map" is not in the source map
+
+consumer.sourceContentFor("this is not in the source map", true);
+// null
+```
+
+#### SourceMapConsumer.prototype.eachMapping(callback, context, order)
+
+Iterate over each mapping between an original source/line/column and a
+generated line/column in this source map.
+
+* `callback`: The function that is called with each mapping. Mappings have the
+  form `{ source, generatedLine, generatedColumn, originalLine, originalColumn,
+  name }`
+
+* `context`: Optional. If specified, this object will be the value of `this`
+  every time that `callback` is called.
+
+* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or
+  `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over
+  the mappings sorted by the generated file's line/column order or the
+  original's source/line/column order, respectively. Defaults to
+  `SourceMapConsumer.GENERATED_ORDER`.
+
+```js
+consumer.eachMapping(function (m) { console.log(m); })
+// ...
+// { source: 'illmatic.js',
+//   generatedLine: 1,
+//   generatedColumn: 0,
+//   originalLine: 1,
+//   originalColumn: 0,
+//   name: null }
+// { source: 'illmatic.js',
+//   generatedLine: 2,
+//   generatedColumn: 0,
+//   originalLine: 2,
+//   originalColumn: 0,
+//   name: null }
+// ...
+```
+### SourceMapGenerator
+
+An instance of the SourceMapGenerator represents a source map which is being
+built incrementally.
+
+#### new SourceMapGenerator([startOfSourceMap])
+
+You may pass an object with the following properties:
+
+* `file`: The filename of the generated source that this source map is
+  associated with.
+
+* `sourceRoot`: A root for all relative URLs in this source map.
+
+* `skipValidation`: Optional. When `true`, disables validation of mappings as
+  they are added. This can improve performance but should be used with
+  discretion, as a last resort. Even then, one should avoid using this flag when
+  running tests, if possible.
+
+```js
+var generator = new sourceMap.SourceMapGenerator({
+  file: "my-generated-javascript-file.js",
+  sourceRoot: "http://example.com/app/js/"
+});
+```
+
+#### SourceMapGenerator.fromSourceMap(sourceMapConsumer)
+
+Creates a new `SourceMapGenerator` from an existing `SourceMapConsumer` instance.
+
+* `sourceMapConsumer` The SourceMap.
+
+```js
+var generator = sourceMap.SourceMapGenerator.fromSourceMap(consumer);
+```
+
+#### SourceMapGenerator.prototype.addMapping(mapping)
+
+Add a single mapping from original source line and column to the generated
+source's line and column for this source map being created. The mapping object
+should have the following properties:
+
+* `generated`: An object with the generated line and column positions.
+
+* `original`: An object with the original line and column positions.
+
+* `source`: The original source file (relative to the sourceRoot).
+
+* `name`: An optional original token name for this mapping.
+
+```js
+generator.addMapping({
+  source: "module-one.scm",
+  original: { line: 128, column: 0 },
+  generated: { line: 3, column: 456 }
+})
+```
+
+#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)
+
+Set the source content for an original source file.
+
+* `sourceFile` the URL of the original source file.
+
+* `sourceContent` the content of the source file.
+
+```js
+generator.setSourceContent("module-one.scm",
+                           fs.readFileSync("path/to/module-one.scm"))
+```
+
+#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])
+
+Applies a SourceMap for a source file to the SourceMap.
+Each mapping to the supplied source file is rewritten using the
+supplied SourceMap. Note: The resolution for the resulting mappings
+is the minimum of this map and the supplied map.
+
+* `sourceMapConsumer`: The SourceMap to be applied.
+
+* `sourceFile`: Optional. The filename of the source file.
+  If omitted, sourceMapConsumer.file will be used, if it exists.
+  Otherwise an error will be thrown.
+
+* `sourceMapPath`: Optional. The dirname of the path to the SourceMap
+  to be applied. If relative, it is relative to the SourceMap.
+
+  This parameter is needed when the two SourceMaps aren't in the same
+  directory, and the SourceMap to be applied contains relative source
+  paths. If so, those relative source paths need to be rewritten
+  relative to the SourceMap.
+
+  If omitted, it is assumed that both SourceMaps are in the same directory,
+  thus not needing any rewriting. (Supplying `'.'` has the same effect.)
+
+#### SourceMapGenerator.prototype.toString()
+
+Renders the source map being generated to a string.
+
+```js
+generator.toString()
+// '{"version":3,"sources":["module-one.scm"],"names":[],"mappings":"...snip...","file":"my-generated-javascript-file.js","sourceRoot":"http://example.com/app/js/"}'
+```
+
+### SourceNode
+
+SourceNodes provide a way to abstract over interpolating and/or concatenating
+snippets of generated JavaScript source code, while maintaining the line and
+column information associated between those snippets and the original source
+code. This is useful as the final intermediate representation a compiler might
+use before outputting the generated JS and source map.
+
+#### new SourceNode([line, column, source[, chunk[, name]]])
+
+* `line`: The original line number associated with this source node, or null if
+  it isn't associated with an original line.
+
+* `column`: The original column number associated with this source node, or null
+  if it isn't associated with an original column.
+
+* `source`: The original source's filename; null if no filename is provided.
+
+* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see
+  below.
+
+* `name`: Optional. The original identifier.
+
+```js
+var node = new SourceNode(1, 2, "a.cpp", [
+  new SourceNode(3, 4, "b.cpp", "extern int status;\n"),
+  new SourceNode(5, 6, "c.cpp", "std::string* make_string(size_t n);\n"),
+  new SourceNode(7, 8, "d.cpp", "int main(int argc, char** argv) {}\n"),
+]);
+```
+
+#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])
+
+Creates a SourceNode from generated code and a SourceMapConsumer.
+
+* `code`: The generated code
+
+* `sourceMapConsumer` The SourceMap for the generated code
+
+* `relativePath` The optional path that relative sources in `sourceMapConsumer`
+  should be relative to.
+
+```js
+var consumer = new SourceMapConsumer(fs.readFileSync("path/to/my-file.js.map", "utf8"));
+var node = SourceNode.fromStringWithSourceMap(fs.readFileSync("path/to/my-file.js"),
+                                              consumer);
+```
+
+#### SourceNode.prototype.add(chunk)
+
+Add a chunk of generated JS to this source node.
+
+* `chunk`: A string snippet of generated JS code, another instance of
+   `SourceNode`, or an array where each member is one of those things.
+
+```js
+node.add(" + ");
+node.add(otherNode);
+node.add([leftHandOperandNode, " + ", rightHandOperandNode]);
+```
+
+#### SourceNode.prototype.prepend(chunk)
+
+Prepend a chunk of generated JS to this source node.
+
+* `chunk`: A string snippet of generated JS code, another instance of
+   `SourceNode`, or an array where each member is one of those things.
+
+```js
+node.prepend("/** Build Id: f783haef86324gf **/\n\n");
+```
+
+#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent)
+
+Set the source content for a source file. This will be added to the
+`SourceMap` in the `sourcesContent` field.
+
+* `sourceFile`: The filename of the source file
+
+* `sourceContent`: The content of the source file
+
+```js
+node.setSourceContent("module-one.scm",
+                      fs.readFileSync("path/to/module-one.scm"))
+```
+
+#### SourceNode.prototype.walk(fn)
+
+Walk over the tree of JS snippets in this node and its children. The walking
+function is called once for each snippet of JS and is passed that snippet and
+the its original associated source's line/column location.
+
+* `fn`: The traversal function.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.walk(function (code, loc) { console.log("WALK:", code, loc); })
+// WALK: uno { source: 'b.js', line: 3, column: 4, name: null }
+// WALK: dos { source: 'a.js', line: 1, column: 2, name: null }
+// WALK: tres { source: 'a.js', line: 1, column: 2, name: null }
+// WALK: quatro { source: 'c.js', line: 5, column: 6, name: null }
+```
+
+#### SourceNode.prototype.walkSourceContents(fn)
+
+Walk over the tree of SourceNodes. The walking function is called for each
+source file content and is passed the filename and source content.
+
+* `fn`: The traversal function.
+
+```js
+var a = new SourceNode(1, 2, "a.js", "generated from a");
+a.setSourceContent("a.js", "original a");
+var b = new SourceNode(1, 2, "b.js", "generated from b");
+b.setSourceContent("b.js", "original b");
+var c = new SourceNode(1, 2, "c.js", "generated from c");
+c.setSourceContent("c.js", "original c");
+
+var node = new SourceNode(null, null, null, [a, b, c]);
+node.walkSourceContents(function (source, contents) { console.log("WALK:", source, ":", contents); })
+// WALK: a.js : original a
+// WALK: b.js : original b
+// WALK: c.js : original c
+```
+
+#### SourceNode.prototype.join(sep)
+
+Like `Array.prototype.join` except for SourceNodes. Inserts the separator
+between each of this source node's children.
+
+* `sep`: The separator.
+
+```js
+var lhs = new SourceNode(1, 2, "a.rs", "my_copy");
+var operand = new SourceNode(3, 4, "a.rs", "=");
+var rhs = new SourceNode(5, 6, "a.rs", "orig.clone()");
+
+var node = new SourceNode(null, null, null, [ lhs, operand, rhs ]);
+var joinedNode = node.join(" ");
+```
+
+#### SourceNode.prototype.replaceRight(pattern, replacement)
+
+Call `String.prototype.replace` on the very right-most source snippet. Useful
+for trimming white space from the end of a source node, etc.
+
+* `pattern`: The pattern to replace.
+
+* `replacement`: The thing to replace the pattern with.
+
+```js
+// Trim trailing white space.
+node.replaceRight(/\s*$/, "");
+```
+
+#### SourceNode.prototype.toString()
+
+Return the string representation of this source node. Walks over the tree and
+concatenates all the various snippets together to one string.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.toString()
+// 'unodostresquatro'
+```
+
+#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])
+
+Returns the string representation of this tree of source nodes, plus a
+SourceMapGenerator which contains all the mappings between the generated and
+original sources.
+
+The arguments are the same as those to `new SourceMapGenerator`.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.toStringWithSourceMap({ file: "my-output-file.js" })
+// { code: 'unodostresquatro',
+//   map: [object SourceMapGenerator] }
+```

node_modules/snapdragon/node_modules/source-map/lib/array-set.js

@@ -0,0 +1,121 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+var has = Object.prototype.hasOwnProperty;
+var hasNativeMap = typeof Map !== "undefined";
+
+/**
+ * A data structure which is a combination of an array and a set. Adding a new
+ * member is O(1), testing for membership is O(1), and finding the index of an
+ * element is O(1). Removing elements from the set is not supported. Only
+ * strings are supported for membership.
+ */
+function ArraySet() {
+  this._array = [];
+  this._set = hasNativeMap ? new Map() : Object.create(null);
+}
+
+/**
+ * Static method for creating ArraySet instances from an existing array.
+ */
+ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
+  var set = new ArraySet();
+  for (var i = 0, len = aArray.length; i < len; i++) {
+    set.add(aArray[i], aAllowDuplicates);
+  }
+  return set;
+};
+
+/**
+ * Return how many unique items are in this ArraySet. If duplicates have been
+ * added, than those do not count towards the size.
+ *
+ * @returns Number
+ */
+ArraySet.prototype.size = function ArraySet_size() {
+  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;
+};
+
+/**
+ * Add the given string to this set.
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
+  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);
+  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);
+  var idx = this._array.length;
+  if (!isDuplicate || aAllowDuplicates) {
+    this._array.push(aStr);
+  }
+  if (!isDuplicate) {
+    if (hasNativeMap) {
+      this._set.set(aStr, idx);
+    } else {
+      this._set[sStr] = idx;
+    }
+  }
+};
+
+/**
+ * Is the given string a member of this set?
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.has = function ArraySet_has(aStr) {
+  if (hasNativeMap) {
+    return this._set.has(aStr);
+  } else {
+    var sStr = util.toSetString(aStr);
+    return has.call(this._set, sStr);
+  }
+};
+
+/**
+ * What is the index of the given string in the array?
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
+  if (hasNativeMap) {
+    var idx = this._set.get(aStr);
+    if (idx >= 0) {
+        return idx;
+    }
+  } else {
+    var sStr = util.toSetString(aStr);
+    if (has.call(this._set, sStr)) {
+      return this._set[sStr];
+    }
+  }
+
+  throw new Error('"' + aStr + '" is not in the set.');
+};
+
+/**
+ * What is the element at the given index?
+ *
+ * @param Number aIdx
+ */
+ArraySet.prototype.at = function ArraySet_at(aIdx) {
+  if (aIdx >= 0 && aIdx < this._array.length) {
+    return this._array[aIdx];
+  }
+  throw new Error('No element indexed by ' + aIdx);
+};
+
+/**
+ * Returns the array representation of this set (which has the proper indices
+ * indicated by indexOf). Note that this is a copy of the internal array used
+ * for storing the members so that no one can mess with internal state.
+ */
+ArraySet.prototype.toArray = function ArraySet_toArray() {
+  return this._array.slice();
+};
+
+exports.ArraySet = ArraySet;

node_modules/snapdragon/node_modules/source-map/lib/base64-vlq.js

@@ -0,0 +1,140 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ *
+ * Based on the Base 64 VLQ implementation in Closure Compiler:
+ * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
+ *
+ * Copyright 2011 The Closure Compiler Authors. All rights reserved.
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions are
+ * met:
+ *
+ *  * Redistributions of source code must retain the above copyright
+ *    notice, this list of conditions and the following disclaimer.
+ *  * Redistributions in binary form must reproduce the above
+ *    copyright notice, this list of conditions and the following
+ *    disclaimer in the documentation and/or other materials provided
+ *    with the distribution.
+ *  * Neither the name of Google Inc. nor the names of its
+ *    contributors may be used to endorse or promote products derived
+ *    from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+ * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+ * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+ * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+var base64 = require('./base64');
+
+// A single base 64 digit can contain 6 bits of data. For the base 64 variable
+// length quantities we use in the source map spec, the first bit is the sign,
+// the next four bits are the actual value, and the 6th bit is the
+// continuation bit. The continuation bit tells us whether there are more
+// digits in this value following this digit.
+//
+//   Continuation
+//   |    Sign
+//   |    |
+//   V    V
+//   101011
+
+var VLQ_BASE_SHIFT = 5;
+
+// binary: 100000
+var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
+
+// binary: 011111
+var VLQ_BASE_MASK = VLQ_BASE - 1;
+
+// binary: 100000
+var VLQ_CONTINUATION_BIT = VLQ_BASE;
+
+/**
+ * Converts from a two-complement value to a value where the sign bit is
+ * placed in the least significant bit.  For example, as decimals:
+ *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
+ *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
+ */
+function toVLQSigned(aValue) {
+  return aValue < 0
+    ? ((-aValue) << 1) + 1
+    : (aValue << 1) + 0;
+}
+
+/**
+ * Converts to a two-complement value from a value where the sign bit is
+ * placed in the least significant bit.  For example, as decimals:
+ *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1
+ *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2
+ */
+function fromVLQSigned(aValue) {
+  var isNegative = (aValue & 1) === 1;
+  var shifted = aValue >> 1;
+  return isNegative
+    ? -shifted
+    : shifted;
+}
+
+/**
+ * Returns the base 64 VLQ encoded value.
+ */
+exports.encode = function base64VLQ_encode(aValue) {
+  var encoded = "";
+  var digit;
+
+  var vlq = toVLQSigned(aValue);
+
+  do {
+    digit = vlq & VLQ_BASE_MASK;
+    vlq >>>= VLQ_BASE_SHIFT;
+    if (vlq > 0) {
+      // There are still more digits in this value, so we must make sure the
+      // continuation bit is marked.
+      digit |= VLQ_CONTINUATION_BIT;
+    }
+    encoded += base64.encode(digit);
+  } while (vlq > 0);
+
+  return encoded;
+};
+
+/**
+ * Decodes the next base 64 VLQ value from the given string and returns the
+ * value and the rest of the string via the out parameter.
+ */
+exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {
+  var strLen = aStr.length;
+  var result = 0;
+  var shift = 0;
+  var continuation, digit;
+
+  do {
+    if (aIndex >= strLen) {
+      throw new Error("Expected more digits in base 64 VLQ value.");
+    }
+
+    digit = base64.decode(aStr.charCodeAt(aIndex++));
+    if (digit === -1) {
+      throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1));
+    }
+
+    continuation = !!(digit & VLQ_CONTINUATION_BIT);
+    digit &= VLQ_BASE_MASK;
+    result = result + (digit << shift);
+    shift += VLQ_BASE_SHIFT;
+  } while (continuation);
+
+  aOutParam.value = fromVLQSigned(result);
+  aOutParam.rest = aIndex;
+};

node_modules/snapdragon/node_modules/source-map/lib/base64.js

@@ -0,0 +1,67 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');
+
+/**
+ * Encode an integer in the range of 0 to 63 to a single base 64 digit.
+ */
+exports.encode = function (number) {
+  if (0 <= number && number < intToCharMap.length) {
+    return intToCharMap[number];
+  }
+  throw new TypeError("Must be between 0 and 63: " + number);
+};
+
+/**
+ * Decode a single base 64 character code digit to an integer. Returns -1 on
+ * failure.
+ */
+exports.decode = function (charCode) {
+  var bigA = 65;     // 'A'
+  var bigZ = 90;     // 'Z'
+
+  var littleA = 97;  // 'a'
+  var littleZ = 122; // 'z'
+
+  var zero = 48;     // '0'
+  var nine = 57;     // '9'
+
+  var plus = 43;     // '+'
+  var slash = 47;    // '/'
+
+  var littleOffset = 26;
+  var numberOffset = 52;
+
+  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ
+  if (bigA <= charCode && charCode <= bigZ) {
+    return (charCode - bigA);
+  }
+
+  // 26 - 51: abcdefghijklmnopqrstuvwxyz
+  if (littleA <= charCode && charCode <= littleZ) {
+    return (charCode - littleA + littleOffset);
+  }
+
+  // 52 - 61: 0123456789
+  if (zero <= charCode && charCode <= nine) {
+    return (charCode - zero + numberOffset);
+  }
+
+  // 62: +
+  if (charCode == plus) {
+    return 62;
+  }
+
+  // 63: /
+  if (charCode == slash) {
+    return 63;
+  }
+
+  // Invalid base64 digit.
+  return -1;
+};

node_modules/snapdragon/node_modules/source-map/lib/binary-search.js

@@ -0,0 +1,111 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+exports.GREATEST_LOWER_BOUND = 1;
+exports.LEAST_UPPER_BOUND = 2;
+
+/**
+ * Recursive implementation of binary search.
+ *
+ * @param aLow Indices here and lower do not contain the needle.
+ * @param aHigh Indices here and higher do not contain the needle.
+ * @param aNeedle The element being searched for.
+ * @param aHaystack The non-empty array being searched.
+ * @param aCompare Function which takes two elements and returns -1, 0, or 1.
+ * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+ *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ */
+function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {
+  // This function terminates when one of the following is true:
+  //
+  //   1. We find the exact element we are looking for.
+  //
+  //   2. We did not find the exact element, but we can return the index of
+  //      the next-closest element.
+  //
+  //   3. We did not find the exact element, and there is no next-closest
+  //      element than the one we are searching for, so we return -1.
+  var mid = Math.floor((aHigh - aLow) / 2) + aLow;
+  var cmp = aCompare(aNeedle, aHaystack[mid], true);
+  if (cmp === 0) {
+    // Found the element we are looking for.
+    return mid;
+  }
+  else if (cmp > 0) {
+    // Our needle is greater than aHaystack[mid].
+    if (aHigh - mid > 1) {
+      // The element is in the upper half.
+      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);
+    }
+
+    // The exact needle element was not found in this haystack. Determine if
+    // we are in termination case (3) or (2) and return the appropriate thing.
+    if (aBias == exports.LEAST_UPPER_BOUND) {
+      return aHigh < aHaystack.length ? aHigh : -1;
+    } else {
+      return mid;
+    }
+  }
+  else {
+    // Our needle is less than aHaystack[mid].
+    if (mid - aLow > 1) {
+      // The element is in the lower half.
+      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);
+    }
+
+    // we are in termination case (3) or (2) and return the appropriate thing.
+    if (aBias == exports.LEAST_UPPER_BOUND) {
+      return mid;
+    } else {
+      return aLow < 0 ? -1 : aLow;
+    }
+  }
+}
+
+/**
+ * This is an implementation of binary search which will always try and return
+ * the index of the closest element if there is no exact hit. This is because
+ * mappings between original and generated line/col pairs are single points,
+ * and there is an implicit region between each of them, so a miss just means
+ * that you aren't on the very start of a region.
+ *
+ * @param aNeedle The element you are looking for.
+ * @param aHaystack The array that is being searched.
+ * @param aCompare A function which takes the needle and an element in the
+ *     array and returns -1, 0, or 1 depending on whether the needle is less
+ *     than, equal to, or greater than the element, respectively.
+ * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+ *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.
+ */
+exports.search = function search(aNeedle, aHaystack, aCompare, aBias) {
+  if (aHaystack.length === 0) {
+    return -1;
+  }
+
+  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,
+                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);
+  if (index < 0) {
+    return -1;
+  }
+
+  // We have found either the exact element, or the next-closest element than
+  // the one we are searching for. However, there may be more than one such
+  // element. Make sure we always return the smallest of these.
+  while (index - 1 >= 0) {
+    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {
+      break;
+    }
+    --index;
+  }
+
+  return index;
+};

node_modules/snapdragon/node_modules/source-map/lib/mapping-list.js

@@ -0,0 +1,79 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2014 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+
+/**
+ * Determine whether mappingB is after mappingA with respect to generated
+ * position.
+ */
+function generatedPositionAfter(mappingA, mappingB) {
+  // Optimized for most common case
+  var lineA = mappingA.generatedLine;
+  var lineB = mappingB.generatedLine;
+  var columnA = mappingA.generatedColumn;
+  var columnB = mappingB.generatedColumn;
+  return lineB > lineA || lineB == lineA && columnB >= columnA ||
+         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;
+}
+
+/**
+ * A data structure to provide a sorted view of accumulated mappings in a
+ * performance conscious manner. It trades a neglibable overhead in general
+ * case for a large speedup in case of mappings being added in order.
+ */
+function MappingList() {
+  this._array = [];
+  this._sorted = true;
+  // Serves as infimum
+  this._last = {generatedLine: -1, generatedColumn: 0};
+}
+
+/**
+ * Iterate through internal items. This method takes the same arguments that
+ * `Array.prototype.forEach` takes.
+ *
+ * NOTE: The order of the mappings is NOT guaranteed.
+ */
+MappingList.prototype.unsortedForEach =
+  function MappingList_forEach(aCallback, aThisArg) {
+    this._array.forEach(aCallback, aThisArg);
+  };
+
+/**
+ * Add the given source mapping.
+ *
+ * @param Object aMapping
+ */
+MappingList.prototype.add = function MappingList_add(aMapping) {
+  if (generatedPositionAfter(this._last, aMapping)) {
+    this._last = aMapping;
+    this._array.push(aMapping);
+  } else {
+    this._sorted = false;
+    this._array.push(aMapping);
+  }
+};
+
+/**
+ * Returns the flat, sorted array of mappings. The mappings are sorted by
+ * generated position.
+ *
+ * WARNING: This method returns internal data without copying, for
+ * performance. The return value must NOT be mutated, and should be treated as
+ * an immutable borrow. If you want to take ownership, you must make your own
+ * copy.
+ */
+MappingList.prototype.toArray = function MappingList_toArray() {
+  if (!this._sorted) {
+    this._array.sort(util.compareByGeneratedPositionsInflated);
+    this._sorted = true;
+  }
+  return this._array;
+};
+
+exports.MappingList = MappingList;

node_modules/snapdragon/node_modules/source-map/lib/quick-sort.js

@@ -0,0 +1,114 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+// It turns out that some (most?) JavaScript engines don't self-host
+// `Array.prototype.sort`. This makes sense because C++ will likely remain
+// faster than JS when doing raw CPU-intensive sorting. However, when using a
+// custom comparator function, calling back and forth between the VM's C++ and
+// JIT'd JS is rather slow *and* loses JIT type information, resulting in
+// worse generated code for the comparator function than would be optimal. In
+// fact, when sorting with a comparator, these costs outweigh the benefits of
+// sorting in C++. By using our own JS-implemented Quick Sort (below), we get
+// a ~3500ms mean speed-up in `bench/bench.html`.
+
+/**
+ * Swap the elements indexed by `x` and `y` in the array `ary`.
+ *
+ * @param {Array} ary
+ *        The array.
+ * @param {Number} x
+ *        The index of the first item.
+ * @param {Number} y
+ *        The index of the second item.
+ */
+function swap(ary, x, y) {
+  var temp = ary[x];
+  ary[x] = ary[y];
+  ary[y] = temp;
+}
+
+/**
+ * Returns a random integer within the range `low .. high` inclusive.
+ *
+ * @param {Number} low
+ *        The lower bound on the range.
+ * @param {Number} high
+ *        The upper bound on the range.
+ */
+function randomIntInRange(low, high) {
+  return Math.round(low + (Math.random() * (high - low)));
+}
+
+/**
+ * The Quick Sort algorithm.
+ *
+ * @param {Array} ary
+ *        An array to sort.
+ * @param {function} comparator
+ *        Function to use to compare two items.
+ * @param {Number} p
+ *        Start index of the array
+ * @param {Number} r
+ *        End index of the array
+ */
+function doQuickSort(ary, comparator, p, r) {
+  // If our lower bound is less than our upper bound, we (1) partition the
+  // array into two pieces and (2) recurse on each half. If it is not, this is
+  // the empty array and our base case.
+
+  if (p < r) {
+    // (1) Partitioning.
+    //
+    // The partitioning chooses a pivot between `p` and `r` and moves all
+    // elements that are less than or equal to the pivot to the before it, and
+    // all the elements that are greater than it after it. The effect is that
+    // once partition is done, the pivot is in the exact place it will be when
+    // the array is put in sorted order, and it will not need to be moved
+    // again. This runs in O(n) time.
+
+    // Always choose a random pivot so that an input array which is reverse
+    // sorted does not cause O(n^2) running time.
+    var pivotIndex = randomIntInRange(p, r);
+    var i = p - 1;
+
+    swap(ary, pivotIndex, r);
+    var pivot = ary[r];
+
+    // Immediately after `j` is incremented in this loop, the following hold
+    // true:
+    //
+    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.
+    //
+    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.
+    for (var j = p; j < r; j++) {
+      if (comparator(ary[j], pivot) <= 0) {
+        i += 1;
+        swap(ary, i, j);
+      }
+    }
+
+    swap(ary, i + 1, j);
+    var q = i + 1;
+
+    // (2) Recurse on each half.
+
+    doQuickSort(ary, comparator, p, q - 1);
+    doQuickSort(ary, comparator, q + 1, r);
+  }
+}
+
+/**
+ * Sort the given array in-place with the given comparator function.
+ *
+ * @param {Array} ary
+ *        An array to sort.
+ * @param {function} comparator
+ *        Function to use to compare two items.
+ */
+exports.quickSort = function (ary, comparator) {
+  doQuickSort(ary, comparator, 0, ary.length - 1);
+};

node_modules/snapdragon/node_modules/source-map/lib/source-map-generator.js

@@ -0,0 +1,416 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var base64VLQ = require('./base64-vlq');
+var util = require('./util');
+var ArraySet = require('./array-set').ArraySet;
+var MappingList = require('./mapping-list').MappingList;
+
+/**
+ * An instance of the SourceMapGenerator represents a source map which is
+ * being built incrementally. You may pass an object with the following
+ * properties:
+ *
+ *   - file: The filename of the generated source.
+ *   - sourceRoot: A root for all relative URLs in this source map.
+ */
+function SourceMapGenerator(aArgs) {
+  if (!aArgs) {
+    aArgs = {};
+  }
+  this._file = util.getArg(aArgs, 'file', null);
+  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
+  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);
+  this._sources = new ArraySet();
+  this._names = new ArraySet();
+  this._mappings = new MappingList();
+  this._sourcesContents = null;
+}
+
+SourceMapGenerator.prototype._version = 3;
+
+/**
+ * Creates a new SourceMapGenerator based on a SourceMapConsumer
+ *
+ * @param aSourceMapConsumer The SourceMap.
+ */
+SourceMapGenerator.fromSourceMap =
+  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
+    var sourceRoot = aSourceMapConsumer.sourceRoot;
+    var generator = new SourceMapGenerator({
+      file: aSourceMapConsumer.file,
+      sourceRoot: sourceRoot
+    });
+    aSourceMapConsumer.eachMapping(function (mapping) {
+      var newMapping = {
+        generated: {
+          line: mapping.generatedLine,
+          column: mapping.generatedColumn
+        }
+      };
+
+      if (mapping.source != null) {
+        newMapping.source = mapping.source;
+        if (sourceRoot != null) {
+          newMapping.source = util.relative(sourceRoot, newMapping.source);
+        }
+
+        newMapping.original = {
+          line: mapping.originalLine,
+          column: mapping.originalColumn
+        };
+
+        if (mapping.name != null) {
+          newMapping.name = mapping.name;
+        }
+      }
+
+      generator.addMapping(newMapping);
+    });
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        generator.setSourceContent(sourceFile, content);
+      }
+    });
+    return generator;
+  };
+
+/**
+ * Add a single mapping from original source line and column to the generated
+ * source's line and column for this source map being created. The mapping
+ * object should have the following properties:
+ *
+ *   - generated: An object with the generated line and column positions.
+ *   - original: An object with the original line and column positions.
+ *   - source: The original source file (relative to the sourceRoot).
+ *   - name: An optional original token name for this mapping.
+ */
+SourceMapGenerator.prototype.addMapping =
+  function SourceMapGenerator_addMapping(aArgs) {
+    var generated = util.getArg(aArgs, 'generated');
+    var original = util.getArg(aArgs, 'original', null);
+    var source = util.getArg(aArgs, 'source', null);
+    var name = util.getArg(aArgs, 'name', null);
+
+    if (!this._skipValidation) {
+      this._validateMapping(generated, original, source, name);
+    }
+
+    if (source != null) {
+      source = String(source);
+      if (!this._sources.has(source)) {
+        this._sources.add(source);
+      }
+    }
+
+    if (name != null) {
+      name = String(name);
+      if (!this._names.has(name)) {
+        this._names.add(name);
+      }
+    }
+
+    this._mappings.add({
+      generatedLine: generated.line,
+      generatedColumn: generated.column,
+      originalLine: original != null && original.line,
+      originalColumn: original != null && original.column,
+      source: source,
+      name: name
+    });
+  };
+
+/**
+ * Set the source content for a source file.
+ */
+SourceMapGenerator.prototype.setSourceContent =
+  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
+    var source = aSourceFile;
+    if (this._sourceRoot != null) {
+      source = util.relative(this._sourceRoot, source);
+    }
+
+    if (aSourceContent != null) {
+      // Add the source content to the _sourcesContents map.
+      // Create a new _sourcesContents map if the property is null.
+      if (!this._sourcesContents) {
+        this._sourcesContents = Object.create(null);
+      }
+      this._sourcesContents[util.toSetString(source)] = aSourceContent;
+    } else if (this._sourcesContents) {
+      // Remove the source file from the _sourcesContents map.
+      // If the _sourcesContents map is empty, set the property to null.
+      delete this._sourcesContents[util.toSetString(source)];
+      if (Object.keys(this._sourcesContents).length === 0) {
+        this._sourcesContents = null;
+      }
+    }
+  };
+
+/**
+ * Applies the mappings of a sub-source-map for a specific source file to the
+ * source map being generated. Each mapping to the supplied source file is
+ * rewritten using the supplied source map. Note: The resolution for the
+ * resulting mappings is the minimium of this map and the supplied map.
+ *
+ * @param aSourceMapConsumer The source map to be applied.
+ * @param aSourceFile Optional. The filename of the source file.
+ *        If omitted, SourceMapConsumer's file property will be used.
+ * @param aSourceMapPath Optional. The dirname of the path to the source map
+ *        to be applied. If relative, it is relative to the SourceMapConsumer.
+ *        This parameter is needed when the two source maps aren't in the same
+ *        directory, and the source map to be applied contains relative source
+ *        paths. If so, those relative source paths need to be rewritten
+ *        relative to the SourceMapGenerator.
+ */
+SourceMapGenerator.prototype.applySourceMap =
+  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
+    var sourceFile = aSourceFile;
+    // If aSourceFile is omitted, we will use the file property of the SourceMap
+    if (aSourceFile == null) {
+      if (aSourceMapConsumer.file == null) {
+        throw new Error(
+          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
+          'or the source map\'s "file" property. Both were omitted.'
+        );
+      }
+      sourceFile = aSourceMapConsumer.file;
+    }
+    var sourceRoot = this._sourceRoot;
+    // Make "sourceFile" relative if an absolute Url is passed.
+    if (sourceRoot != null) {
+      sourceFile = util.relative(sourceRoot, sourceFile);
+    }
+    // Applying the SourceMap can add and remove items from the sources and
+    // the names array.
+    var newSources = new ArraySet();
+    var newNames = new ArraySet();
+
+    // Find mappings for the "sourceFile"
+    this._mappings.unsortedForEach(function (mapping) {
+      if (mapping.source === sourceFile && mapping.originalLine != null) {
+        // Check if it can be mapped by the source map, then update the mapping.
+        var original = aSourceMapConsumer.originalPositionFor({
+          line: mapping.originalLine,
+          column: mapping.originalColumn
+        });
+        if (original.source != null) {
+          // Copy mapping
+          mapping.source = original.source;
+          if (aSourceMapPath != null) {
+            mapping.source = util.join(aSourceMapPath, mapping.source)
+          }
+          if (sourceRoot != null) {
+            mapping.source = util.relative(sourceRoot, mapping.source);
+          }
+          mapping.originalLine = original.line;
+          mapping.originalColumn = original.column;
+          if (original.name != null) {
+            mapping.name = original.name;
+          }
+        }
+      }
+
+      var source = mapping.source;
+      if (source != null && !newSources.has(source)) {
+        newSources.add(source);
+      }
+
+      var name = mapping.name;
+      if (name != null && !newNames.has(name)) {
+        newNames.add(name);
+      }
+
+    }, this);
+    this._sources = newSources;
+    this._names = newNames;
+
+    // Copy sourcesContents of applied map.
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        if (aSourceMapPath != null) {
+          sourceFile = util.join(aSourceMapPath, sourceFile);
+        }
+        if (sourceRoot != null) {
+          sourceFile = util.relative(sourceRoot, sourceFile);
+        }
+        this.setSourceContent(sourceFile, content);
+      }
+    }, this);
+  };
+
+/**
+ * A mapping can have one of the three levels of data:
+ *
+ *   1. Just the generated position.
+ *   2. The Generated position, original position, and original source.
+ *   3. Generated and original position, original source, as well as a name
+ *      token.
+ *
+ * To maintain consistency, we validate that any new mapping being added falls
+ * in to one of these categories.
+ */
+SourceMapGenerator.prototype._validateMapping =
+  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
+                                              aName) {
+    // When aOriginal is truthy but has empty values for .line and .column,
+    // it is most likely a programmer error. In this case we throw a very
+    // specific error message to try to guide them the right way.
+    // For example: https://github.com/Polymer/polymer-bundler/pull/519
+    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {
+        throw new Error(
+            'original.line and original.column are not numbers -- you probably meant to omit ' +
+            'the original mapping entirely and only map the generated position. If so, pass ' +
+            'null for the original mapping instead of an object with empty or null values.'
+        );
+    }
+
+    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+        && aGenerated.line > 0 && aGenerated.column >= 0
+        && !aOriginal && !aSource && !aName) {
+      // Case 1.
+      return;
+    }
+    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+             && aOriginal && 'line' in aOriginal && 'column' in aOriginal
+             && aGenerated.line > 0 && aGenerated.column >= 0
+             && aOriginal.line > 0 && aOriginal.column >= 0
+             && aSource) {
+      // Cases 2 and 3.
+      return;
+    }
+    else {
+      throw new Error('Invalid mapping: ' + JSON.stringify({
+        generated: aGenerated,
+        source: aSource,
+        original: aOriginal,
+        name: aName
+      }));
+    }
+  };
+
+/**
+ * Serialize the accumulated mappings in to the stream of base 64 VLQs
+ * specified by the source map format.
+ */
+SourceMapGenerator.prototype._serializeMappings =
+  function SourceMapGenerator_serializeMappings() {
+    var previousGeneratedColumn = 0;
+    var previousGeneratedLine = 1;
+    var previousOriginalColumn = 0;
+    var previousOriginalLine = 0;
+    var previousName = 0;
+    var previousSource = 0;
+    var result = '';
+    var next;
+    var mapping;
+    var nameIdx;
+    var sourceIdx;
+
+    var mappings = this._mappings.toArray();
+    for (var i = 0, len = mappings.length; i < len; i++) {
+      mapping = mappings[i];
+      next = ''
+
+      if (mapping.generatedLine !== previousGeneratedLine) {
+        previousGeneratedColumn = 0;
+        while (mapping.generatedLine !== previousGeneratedLine) {
+          next += ';';
+          previousGeneratedLine++;
+        }
+      }
+      else {
+        if (i > 0) {
+          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {
+            continue;
+          }
+          next += ',';
+        }
+      }
+
+      next += base64VLQ.encode(mapping.generatedColumn
+                                 - previousGeneratedColumn);
+      previousGeneratedColumn = mapping.generatedColumn;
+
+      if (mapping.source != null) {
+        sourceIdx = this._sources.indexOf(mapping.source);
+        next += base64VLQ.encode(sourceIdx - previousSource);
+        previousSource = sourceIdx;
+
+        // lines are stored 0-based in SourceMap spec version 3
+        next += base64VLQ.encode(mapping.originalLine - 1
+                                   - previousOriginalLine);
+        previousOriginalLine = mapping.originalLine - 1;
+
+        next += base64VLQ.encode(mapping.originalColumn
+                                   - previousOriginalColumn);
+        previousOriginalColumn = mapping.originalColumn;
+
+        if (mapping.name != null) {
+          nameIdx = this._names.indexOf(mapping.name);
+          next += base64VLQ.encode(nameIdx - previousName);
+          previousName = nameIdx;
+        }
+      }
+
+      result += next;
+    }
+
+    return result;
+  };
+
+SourceMapGenerator.prototype._generateSourcesContent =
+  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
+    return aSources.map(function (source) {
+      if (!this._sourcesContents) {
+        return null;
+      }
+      if (aSourceRoot != null) {
+        source = util.relative(aSourceRoot, source);
+      }
+      var key = util.toSetString(source);
+      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)
+        ? this._sourcesContents[key]
+        : null;
+    }, this);
+  };
+
+/**
+ * Externalize the source map.
+ */
+SourceMapGenerator.prototype.toJSON =
+  function SourceMapGenerator_toJSON() {
+    var map = {
+      version: this._version,
+      sources: this._sources.toArray(),
+      names: this._names.toArray(),
+      mappings: this._serializeMappings()
+    };
+    if (this._file != null) {
+      map.file = this._file;
+    }
+    if (this._sourceRoot != null) {
+      map.sourceRoot = this._sourceRoot;
+    }
+    if (this._sourcesContents) {
+      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
+    }
+
+    return map;
+  };
+
+/**
+ * Render the source map being generated to a string.
+ */
+SourceMapGenerator.prototype.toString =
+  function SourceMapGenerator_toString() {
+    return JSON.stringify(this.toJSON());
+  };
+
+exports.SourceMapGenerator = SourceMapGenerator;

node_modules/snapdragon/node_modules/source-map/lib/source-node.js

@@ -0,0 +1,413 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;
+var util = require('./util');
+
+// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other
+// operating systems these days (capturing the result).
+var REGEX_NEWLINE = /(\r?\n)/;
+
+// Newline character code for charCodeAt() comparisons
+var NEWLINE_CODE = 10;
+
+// Private symbol for identifying `SourceNode`s when multiple versions of
+// the source-map library are loaded. This MUST NOT CHANGE across
+// versions!
+var isSourceNode = "$$$isSourceNode$$$";
+
+/**
+ * SourceNodes provide a way to abstract over interpolating/concatenating
+ * snippets of generated JavaScript source code while maintaining the line and
+ * column information associated with the original source code.
+ *
+ * @param aLine The original line number.
+ * @param aColumn The original column number.
+ * @param aSource The original source's filename.
+ * @param aChunks Optional. An array of strings which are snippets of
+ *        generated JS, or other SourceNodes.
+ * @param aName The original identifier.
+ */
+function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
+  this.children = [];
+  this.sourceContents = {};
+  this.line = aLine == null ? null : aLine;
+  this.column = aColumn == null ? null : aColumn;
+  this.source = aSource == null ? null : aSource;
+  this.name = aName == null ? null : aName;
+  this[isSourceNode] = true;
+  if (aChunks != null) this.add(aChunks);
+}
+
+/**
+ * Creates a SourceNode from generated code and a SourceMapConsumer.
+ *
+ * @param aGeneratedCode The generated code
+ * @param aSourceMapConsumer The SourceMap for the generated code
+ * @param aRelativePath Optional. The path that relative sources in the
+ *        SourceMapConsumer should be relative to.
+ */
+SourceNode.fromStringWithSourceMap =
+  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {
+    // The SourceNode we want to fill with the generated code
+    // and the SourceMap
+    var node = new SourceNode();
+
+    // All even indices of this array are one line of the generated code,
+    // while all odd indices are the newlines between two adjacent lines
+    // (since `REGEX_NEWLINE` captures its match).
+    // Processed fragments are accessed by calling `shiftNextLine`.
+    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);
+    var remainingLinesIndex = 0;
+    var shiftNextLine = function() {
+      var lineContents = getNextLine();
+      // The last line of a file might not have a newline.
+      var newLine = getNextLine() || "";
+      return lineContents + newLine;
+
+      function getNextLine() {
+        return remainingLinesIndex < remainingLines.length ?
+            remainingLines[remainingLinesIndex++] : undefined;
+      }
+    };
+
+    // We need to remember the position of "remainingLines"
+    var lastGeneratedLine = 1, lastGeneratedColumn = 0;
+
+    // The generate SourceNodes we need a code range.
+    // To extract it current and last mapping is used.
+    // Here we store the last mapping.
+    var lastMapping = null;
+
+    aSourceMapConsumer.eachMapping(function (mapping) {
+      if (lastMapping !== null) {
+        // We add the code from "lastMapping" to "mapping":
+        // First check if there is a new line in between.
+        if (lastGeneratedLine < mapping.generatedLine) {
+          // Associate first line with "lastMapping"
+          addMappingWithCode(lastMapping, shiftNextLine());
+          lastGeneratedLine++;
+          lastGeneratedColumn = 0;
+          // The remaining code is added without mapping
+        } else {
+          // There is no new line in between.
+          // Associate the code between "lastGeneratedColumn" and
+          // "mapping.generatedColumn" with "lastMapping"
+          var nextLine = remainingLines[remainingLinesIndex];
+          var code = nextLine.substr(0, mapping.generatedColumn -
+                                        lastGeneratedColumn);
+          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -
+                                              lastGeneratedColumn);
+          lastGeneratedColumn = mapping.generatedColumn;
+          addMappingWithCode(lastMapping, code);
+          // No more remaining code, continue
+          lastMapping = mapping;
+          return;
+        }
+      }
+      // We add the generated code until the first mapping
+      // to the SourceNode without any mapping.
+      // Each line is added as separate string.
+      while (lastGeneratedLine < mapping.generatedLine) {
+        node.add(shiftNextLine());
+        lastGeneratedLine++;
+      }
+      if (lastGeneratedColumn < mapping.generatedColumn) {
+        var nextLine = remainingLines[remainingLinesIndex];
+        node.add(nextLine.substr(0, mapping.generatedColumn));
+        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);
+        lastGeneratedColumn = mapping.generatedColumn;
+      }
+      lastMapping = mapping;
+    }, this);
+    // We have processed all mappings.
+    if (remainingLinesIndex < remainingLines.length) {
+      if (lastMapping) {
+        // Associate the remaining code in the current line with "lastMapping"
+        addMappingWithCode(lastMapping, shiftNextLine());
+      }
+      // and add the remaining lines without any mapping
+      node.add(remainingLines.splice(remainingLinesIndex).join(""));
+    }
+
+    // Copy sourcesContent into SourceNode
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        if (aRelativePath != null) {
+          sourceFile = util.join(aRelativePath, sourceFile);
+        }
+        node.setSourceContent(sourceFile, content);
+      }
+    });
+
+    return node;
+
+    function addMappingWithCode(mapping, code) {
+      if (mapping === null || mapping.source === undefined) {
+        node.add(code);
+      } else {
+        var source = aRelativePath
+          ? util.join(aRelativePath, mapping.source)
+          : mapping.source;
+        node.add(new SourceNode(mapping.originalLine,
+                                mapping.originalColumn,
+                                source,
+                                code,
+                                mapping.name));
+      }
+    }
+  };
+
+/**
+ * Add a chunk of generated JS to this source node.
+ *
+ * @param aChunk A string snippet of generated JS code, another instance of
+ *        SourceNode, or an array where each member is one of those things.
+ */
+SourceNode.prototype.add = function SourceNode_add(aChunk) {
+  if (Array.isArray(aChunk)) {
+    aChunk.forEach(function (chunk) {
+      this.add(chunk);
+    }, this);
+  }
+  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+    if (aChunk) {
+      this.children.push(aChunk);
+    }
+  }
+  else {
+    throw new TypeError(
+      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+    );
+  }
+  return this;
+};
+
+/**
+ * Add a chunk of generated JS to the beginning of this source node.
+ *
+ * @param aChunk A string snippet of generated JS code, another instance of
+ *        SourceNode, or an array where each member is one of those things.
+ */
+SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
+  if (Array.isArray(aChunk)) {
+    for (var i = aChunk.length-1; i >= 0; i--) {
+      this.prepend(aChunk[i]);
+    }
+  }
+  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+    this.children.unshift(aChunk);
+  }
+  else {
+    throw new TypeError(
+      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+    );
+  }
+  return this;
+};
+
+/**
+ * Walk over the tree of JS snippets in this node and its children. The
+ * walking function is called once for each snippet of JS and is passed that
+ * snippet and the its original associated source's line/column location.
+ *
+ * @param aFn The traversal function.
+ */
+SourceNode.prototype.walk = function SourceNode_walk(aFn) {
+  var chunk;
+  for (var i = 0, len = this.children.length; i < len; i++) {
+    chunk = this.children[i];
+    if (chunk[isSourceNode]) {
+      chunk.walk(aFn);
+    }
+    else {
+      if (chunk !== '') {
+        aFn(chunk, { source: this.source,
+                     line: this.line,
+                     column: this.column,
+                     name: this.name });
+      }
+    }
+  }
+};
+
+/**
+ * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
+ * each of `this.children`.
+ *
+ * @param aSep The separator.
+ */
+SourceNode.prototype.join = function SourceNode_join(aSep) {
+  var newChildren;
+  var i;
+  var len = this.children.length;
+  if (len > 0) {
+    newChildren = [];
+    for (i = 0; i < len-1; i++) {
+      newChildren.push(this.children[i]);
+      newChildren.push(aSep);
+    }
+    newChildren.push(this.children[i]);
+    this.children = newChildren;
+  }
+  return this;
+};
+
+/**
+ * Call String.prototype.replace on the very right-most source snippet. Useful
+ * for trimming whitespace from the end of a source node, etc.
+ *
+ * @param aPattern The pattern to replace.
+ * @param aReplacement The thing to replace the pattern with.
+ */
+SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
+  var lastChild = this.children[this.children.length - 1];
+  if (lastChild[isSourceNode]) {
+    lastChild.replaceRight(aPattern, aReplacement);
+  }
+  else if (typeof lastChild === 'string') {
+    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
+  }
+  else {
+    this.children.push(''.replace(aPattern, aReplacement));
+  }
+  return this;
+};
+
+/**
+ * Set the source content for a source file. This will be added to the SourceMapGenerator
+ * in the sourcesContent field.
+ *
+ * @param aSourceFile The filename of the source file
+ * @param aSourceContent The content of the source file
+ */
+SourceNode.prototype.setSourceContent =
+  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
+    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
+  };
+
+/**
+ * Walk over the tree of SourceNodes. The walking function is called for each
+ * source file content and is passed the filename and source content.
+ *
+ * @param aFn The traversal function.
+ */
+SourceNode.prototype.walkSourceContents =
+  function SourceNode_walkSourceContents(aFn) {
+    for (var i = 0, len = this.children.length; i < len; i++) {
+      if (this.children[i][isSourceNode]) {
+        this.children[i].walkSourceContents(aFn);
+      }
+    }
+
+    var sources = Object.keys(this.sourceContents);
+    for (var i = 0, len = sources.length; i < len; i++) {
+      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
+    }
+  };
+
+/**
+ * Return the string representation of this source node. Walks over the tree
+ * and concatenates all the various snippets together to one string.
+ */
+SourceNode.prototype.toString = function SourceNode_toString() {
+  var str = "";
+  this.walk(function (chunk) {
+    str += chunk;
+  });
+  return str;
+};
+
+/**
+ * Returns the string representation of this source node along with a source
+ * map.
+ */
+SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
+  var generated = {
+    code: "",
+    line: 1,
+    column: 0
+  };
+  var map = new SourceMapGenerator(aArgs);
+  var sourceMappingActive = false;
+  var lastOriginalSource = null;
+  var lastOriginalLine = null;
+  var lastOriginalColumn = null;
+  var lastOriginalName = null;
+  this.walk(function (chunk, original) {
+    generated.code += chunk;
+    if (original.source !== null
+        && original.line !== null
+        && original.column !== null) {
+      if(lastOriginalSource !== original.source
+         || lastOriginalLine !== original.line
+         || lastOriginalColumn !== original.column
+         || lastOriginalName !== original.name) {
+        map.addMapping({
+          source: original.source,
+          original: {
+            line: original.line,
+            column: original.column
+          },
+          generated: {
+            line: generated.line,
+            column: generated.column
+          },
+          name: original.name
+        });
+      }
+      lastOriginalSource = original.source;
+      lastOriginalLine = original.line;
+      lastOriginalColumn = original.column;
+      lastOriginalName = original.name;
+      sourceMappingActive = true;
+    } else if (sourceMappingActive) {
+      map.addMapping({
+        generated: {
+          line: generated.line,
+          column: generated.column
+        }
+      });
+      lastOriginalSource = null;
+      sourceMappingActive = false;
+    }
+    for (var idx = 0, length = chunk.length; idx < length; idx++) {
+      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {
+        generated.line++;
+        generated.column = 0;
+        // Mappings end at eol
+        if (idx + 1 === length) {
+          lastOriginalSource = null;
+          sourceMappingActive = false;
+        } else if (sourceMappingActive) {
+          map.addMapping({
+            source: original.source,
+            original: {
+              line: original.line,
+              column: original.column
+            },
+            generated: {
+              line: generated.line,
+              column: generated.column
+            },
+            name: original.name
+          });
+        }
+      } else {
+        generated.column++;
+      }
+    }
+  });
+  this.walkSourceContents(function (sourceFile, sourceContent) {
+    map.setSourceContent(sourceFile, sourceContent);
+  });
+
+  return { code: generated.code, map: map };
+};
+
+exports.SourceNode = SourceNode;

node_modules/snapdragon/node_modules/source-map/lib/util.js

@@ -0,0 +1,417 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+/**
+ * This is a helper function for getting values from parameter/options
+ * objects.
+ *
+ * @param args The object we are extracting values from
+ * @param name The name of the property we are getting.
+ * @param defaultValue An optional value to return if the property is missing
+ * from the object. If this is not specified and the property is missing, an
+ * error will be thrown.
+ */
+function getArg(aArgs, aName, aDefaultValue) {
+  if (aName in aArgs) {
+    return aArgs[aName];
+  } else if (arguments.length === 3) {
+    return aDefaultValue;
+  } else {
+    throw new Error('"' + aName + '" is a required argument.');
+  }
+}
+exports.getArg = getArg;
+
+var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.]*)(?::(\d+))?(\S*)$/;
+var dataUrlRegexp = /^data:.+\,.+$/;
+
+function urlParse(aUrl) {
+  var match = aUrl.match(urlRegexp);
+  if (!match) {
+    return null;
+  }
+  return {
+    scheme: match[1],
+    auth: match[2],
+    host: match[3],
+    port: match[4],
+    path: match[5]
+  };
+}
+exports.urlParse = urlParse;
+
+function urlGenerate(aParsedUrl) {
+  var url = '';
+  if (aParsedUrl.scheme) {
+    url += aParsedUrl.scheme + ':';
+  }
+  url += '//';
+  if (aParsedUrl.auth) {
+    url += aParsedUrl.auth + '@';
+  }
+  if (aParsedUrl.host) {
+    url += aParsedUrl.host;
+  }
+  if (aParsedUrl.port) {
+    url += ":" + aParsedUrl.port
+  }
+  if (aParsedUrl.path) {
+    url += aParsedUrl.path;
+  }
+  return url;
+}
+exports.urlGenerate = urlGenerate;
+
+/**
+ * Normalizes a path, or the path portion of a URL:
+ *
+ * - Replaces consecutive slashes with one slash.
+ * - Removes unnecessary '.' parts.
+ * - Removes unnecessary '<dir>/..' parts.
+ *
+ * Based on code in the Node.js 'path' core module.
+ *
+ * @param aPath The path or url to normalize.
+ */
+function normalize(aPath) {
+  var path = aPath;
+  var url = urlParse(aPath);
+  if (url) {
+    if (!url.path) {
+      return aPath;
+    }
+    path = url.path;
+  }
+  var isAbsolute = exports.isAbsolute(path);
+
+  var parts = path.split(/\/+/);
+  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
+    part = parts[i];
+    if (part === '.') {
+      parts.splice(i, 1);
+    } else if (part === '..') {
+      up++;
+    } else if (up > 0) {
+      if (part === '') {
+        // The first part is blank if the path is absolute. Trying to go
+        // above the root is a no-op. Therefore we can remove all '..' parts
+        // directly after the root.
+        parts.splice(i + 1, up);
+        up = 0;
+      } else {
+        parts.splice(i, 2);
+        up--;
+      }
+    }
+  }
+  path = parts.join('/');
+
+  if (path === '') {
+    path = isAbsolute ? '/' : '.';
+  }
+
+  if (url) {
+    url.path = path;
+    return urlGenerate(url);
+  }
+  return path;
+}
+exports.normalize = normalize;
+
+/**
+ * Joins two paths/URLs.
+ *
+ * @param aRoot The root path or URL.
+ * @param aPath The path or URL to be joined with the root.
+ *
+ * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
+ *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended
+ *   first.
+ * - Otherwise aPath is a path. If aRoot is a URL, then its path portion
+ *   is updated with the result and aRoot is returned. Otherwise the result
+ *   is returned.
+ *   - If aPath is absolute, the result is aPath.
+ *   - Otherwise the two paths are joined with a slash.
+ * - Joining for example 'http://' and 'www.example.com' is also supported.
+ */
+function join(aRoot, aPath) {
+  if (aRoot === "") {
+    aRoot = ".";
+  }
+  if (aPath === "") {
+    aPath = ".";
+  }
+  var aPathUrl = urlParse(aPath);
+  var aRootUrl = urlParse(aRoot);
+  if (aRootUrl) {
+    aRoot = aRootUrl.path || '/';
+  }
+
+  // `join(foo, '//www.example.org')`
+  if (aPathUrl && !aPathUrl.scheme) {
+    if (aRootUrl) {
+      aPathUrl.scheme = aRootUrl.scheme;
+    }
+    return urlGenerate(aPathUrl);
+  }
+
+  if (aPathUrl || aPath.match(dataUrlRegexp)) {
+    return aPath;
+  }
+
+  // `join('http://', 'www.example.com')`
+  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
+    aRootUrl.host = aPath;
+    return urlGenerate(aRootUrl);
+  }
+
+  var joined = aPath.charAt(0) === '/'
+    ? aPath
+    : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
+
+  if (aRootUrl) {
+    aRootUrl.path = joined;
+    return urlGenerate(aRootUrl);
+  }
+  return joined;
+}
+exports.join = join;
+
+exports.isAbsolute = function (aPath) {
+  return aPath.charAt(0) === '/' || !!aPath.match(urlRegexp);
+};
+
+/**
+ * Make a path relative to a URL or another path.
+ *
+ * @param aRoot The root path or URL.
+ * @param aPath The path or URL to be made relative to aRoot.
+ */
+function relative(aRoot, aPath) {
+  if (aRoot === "") {
+    aRoot = ".";
+  }
+
+  aRoot = aRoot.replace(/\/$/, '');
+
+  // It is possible for the path to be above the root. In this case, simply
+  // checking whether the root is a prefix of the path won't work. Instead, we
+  // need to remove components from the root one by one, until either we find
+  // a prefix that fits, or we run out of components to remove.
+  var level = 0;
+  while (aPath.indexOf(aRoot + '/') !== 0) {
+    var index = aRoot.lastIndexOf("/");
+    if (index < 0) {
+      return aPath;
+    }
+
+    // If the only part of the root that is left is the scheme (i.e. http://,
+    // file:///, etc.), one or more slashes (/), or simply nothing at all, we
+    // have exhausted all components, so the path is not relative to the root.
+    aRoot = aRoot.slice(0, index);
+    if (aRoot.match(/^([^\/]+:\/)?\/*$/)) {
+      return aPath;
+    }
+
+    ++level;
+  }
+
+  // Make sure we add a "../" for each component we removed from the root.
+  return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1);
+}
+exports.relative = relative;
+
+var supportsNullProto = (function () {
+  var obj = Object.create(null);
+  return !('__proto__' in obj);
+}());
+
+function identity (s) {
+  return s;
+}
+
+/**
+ * Because behavior goes wacky when you set `__proto__` on objects, we
+ * have to prefix all the strings in our set with an arbitrary character.
+ *
+ * See https://github.com/mozilla/source-map/pull/31 and
+ * https://github.com/mozilla/source-map/issues/30
+ *
+ * @param String aStr
+ */
+function toSetString(aStr) {
+  if (isProtoString(aStr)) {
+    return '$' + aStr;
+  }
+
+  return aStr;
+}
+exports.toSetString = supportsNullProto ? identity : toSetString;
+
+function fromSetString(aStr) {
+  if (isProtoString(aStr)) {
+    return aStr.slice(1);
+  }
+
+  return aStr;
+}
+exports.fromSetString = supportsNullProto ? identity : fromSetString;
+
+function isProtoString(s) {
+  if (!s) {
+    return false;
+  }
+
+  var length = s.length;
+
+  if (length < 9 /* "__proto__".length */) {
+    return false;
+  }
+
+  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 2) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||
+      s.charCodeAt(length - 4) !== 116 /* 't' */ ||
+      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||
+      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||
+      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||
+      s.charCodeAt(length - 8) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 9) !== 95  /* '_' */) {
+    return false;
+  }
+
+  for (var i = length - 10; i >= 0; i--) {
+    if (s.charCodeAt(i) !== 36 /* '$' */) {
+      return false;
+    }
+  }
+
+  return true;
+}
+
+/**
+ * Comparator between two mappings where the original positions are compared.
+ *
+ * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+ * mappings with the same original source/line/column, but different generated
+ * line and column the same. Useful when searching for a mapping with a
+ * stubbed out mapping.
+ */
+function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
+  var cmp = mappingA.source - mappingB.source;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0 || onlyCompareOriginal) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return mappingA.name - mappingB.name;
+}
+exports.compareByOriginalPositions = compareByOriginalPositions;
+
+/**
+ * Comparator between two mappings with deflated source and name indices where
+ * the generated positions are compared.
+ *
+ * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+ * mappings with the same generated line and column, but different
+ * source/name/original line and column the same. Useful when searching for a
+ * mapping with a stubbed out mapping.
+ */
+function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {
+  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0 || onlyCompareGenerated) {
+    return cmp;
+  }
+
+  cmp = mappingA.source - mappingB.source;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return mappingA.name - mappingB.name;
+}
+exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;
+
+function strcmp(aStr1, aStr2) {
+  if (aStr1 === aStr2) {
+    return 0;
+  }
+
+  if (aStr1 > aStr2) {
+    return 1;
+  }
+
+  return -1;
+}
+
+/**
+ * Comparator between two mappings with inflated source and name strings where
+ * the generated positions are compared.
+ */
+function compareByGeneratedPositionsInflated(mappingA, mappingB) {
+  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = strcmp(mappingA.source, mappingB.source);
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return strcmp(mappingA.name, mappingB.name);
+}
+exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;

node_modules/snapdragon/node_modules/source-map/package.json

@@ -0,0 +1,72 @@
+{
+  "name": "source-map",
+  "description": "Generates and consumes source maps",
+  "version": "0.5.7",
+  "homepage": "https://github.com/mozilla/source-map",
+  "author": "Nick Fitzgerald <nfitzgerald@mozilla.com>",
+  "contributors": [
+    "Tobias Koppers <tobias.koppers@googlemail.com>",
+    "Duncan Beevers <duncan@dweebd.com>",
+    "Stephen Crane <scrane@mozilla.com>",
+    "Ryan Seddon <seddon.ryan@gmail.com>",
+    "Miles Elam <miles.elam@deem.com>",
+    "Mihai Bazon <mihai.bazon@gmail.com>",
+    "Michael Ficarra <github.public.email@michael.ficarra.me>",
+    "Todd Wolfson <todd@twolfson.com>",
+    "Alexander Solovyov <alexander@solovyov.net>",
+    "Felix Gnass <fgnass@gmail.com>",
+    "Conrad Irwin <conrad.irwin@gmail.com>",
+    "usrbincc <usrbincc@yahoo.com>",
+    "David Glasser <glasser@davidglasser.net>",
+    "Chase Douglas <chase@newrelic.com>",
+    "Evan Wallace <evan.exe@gmail.com>",
+    "Heather Arthur <fayearthur@gmail.com>",
+    "Hugh Kennedy <hughskennedy@gmail.com>",
+    "David Glasser <glasser@davidglasser.net>",
+    "Simon Lydell <simon.lydell@gmail.com>",
+    "Jmeas Smith <jellyes2@gmail.com>",
+    "Michael Z Goddard <mzgoddard@gmail.com>",
+    "azu <azu@users.noreply.github.com>",
+    "John Gozde <john@gozde.ca>",
+    "Adam Kirkton <akirkton@truefitinnovation.com>",
+    "Chris Montgomery <christopher.montgomery@dowjones.com>",
+    "J. Ryan Stinnett <jryans@gmail.com>",
+    "Jack Herrington <jherrington@walmartlabs.com>",
+    "Chris Truter <jeffpalentine@gmail.com>",
+    "Daniel Espeset <daniel@danielespeset.com>",
+    "Jamie Wong <jamie.lf.wong@gmail.com>",
+    "Eddy Bruël <ejpbruel@mozilla.com>",
+    "Hawken Rives <hawkrives@gmail.com>",
+    "Gilad Peleg <giladp007@gmail.com>",
+    "djchie <djchie.dev@gmail.com>",
+    "Gary Ye <garysye@gmail.com>",
+    "Nicolas Lalevée <nicolas.lalevee@hibnet.org>"
+  ],
+  "repository": {
+    "type": "git",
+    "url": "http://github.com/mozilla/source-map.git"
+  },
+  "main": "./source-map.js",
+  "files": [
+    "source-map.js",
+    "lib/",
+    "dist/source-map.debug.js",
+    "dist/source-map.js",
+    "dist/source-map.min.js",
+    "dist/source-map.min.js.map"
+  ],
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "license": "BSD-3-Clause",
+  "scripts": {
+    "test": "npm run build && node test/run-tests.js",
+    "build": "webpack --color",
+    "toc": "doctoc --title '## Table of Contents' README.md && doctoc --title '## Table of Contents' CONTRIBUTING.md"
+  },
+  "devDependencies": {
+    "doctoc": "^0.15.0",
+    "webpack": "^1.12.0"
+  },
+  "typings": "source-map"
+}

node_modules/snapdragon/node_modules/source-map/source-map.js

@@ -0,0 +1,8 @@
+/*
+ * Copyright 2009-2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE.txt or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+exports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator;
+exports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer;
+exports.SourceNode = require('./lib/source-node').SourceNode;

node_modules/snapdragon/package.json

@@ -0,0 +1,79 @@
+{
+  "name": "snapdragon",
+  "description": "Fast, pluggable and easy-to-use parser-renderer factory.",
+  "version": "0.8.2",
+  "homepage": "https://github.com/jonschlinkert/snapdragon",
+  "author": "Jon Schlinkert (https://github.com/jonschlinkert)",
+  "contributors": [
+    "Brian Woodward (https://twitter.com/doowb)",
+    "Edward Betts (http://edwardbetts.com)",
+    "Jon Schlinkert (http://twitter.com/jonschlinkert)"
+  ],
+  "repository": "jonschlinkert/snapdragon",
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/snapdragon/issues"
+  },
+  "license": "MIT",
+  "files": [
+    "index.js",
+    "lib"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "dependencies": {
+    "base": "^0.11.1",
+    "debug": "^2.2.0",
+    "define-property": "^0.2.5",
+    "extend-shallow": "^2.0.1",
+    "map-cache": "^0.2.2",
+    "source-map": "^0.5.6",
+    "source-map-resolve": "^0.5.0",
+    "use": "^3.1.0"
+  },
+  "devDependencies": {
+    "gulp": "^3.9.1",
+    "gulp-eslint": "^3.0.1",
+    "gulp-format-md": "^0.1.10",
+    "gulp-istanbul": "^1.1.1",
+    "gulp-mocha": "^3.0.1",
+    "gulp-unused": "^0.2.0",
+    "mocha": "^3.0.2"
+  },
+  "keywords": [
+    "lexer",
+    "snapdragon"
+  ],
+  "verb": {
+    "toc": false,
+    "layout": "default",
+    "tasks": [
+      "readme"
+    ],
+    "plugins": [
+      "gulp-format-md"
+    ],
+    "related": {
+      "description": "These libraries use snapdragon:",
+      "list": [
+        "braces",
+        "expand-brackets",
+        "extglob",
+        "micromatch"
+      ]
+    },
+    "reflinks": [
+      "css",
+      "pug",
+      "verb",
+      "verb-generate-readme"
+    ],
+    "lint": {
+      "reflinks": true
+    }
+  }
+}